Introduction：Basic information about Decanoic acid, 2-[4-(phenylMethoxy)phenyl]ethyl ester CAS 848484-93-5, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Decanoic acid, 2-[4-(phenylMethoxy)phenyl]ethyl ester Basic information
| Product Name: | Decanoic acid, 2-[4-(phenylMethoxy)phenyl]ethyl ester |
| Synonyms: | Decanoic acid, 2-[4-(phenylMethoxy)phenyl]ethyl ester;4-(Benzyloxy)phenethyl decanoate;2-(4-Benzyloxyphenyl)ethyl decanoate;Decanoic acid, 2-[4-(phenylmethoxy)phenyl]ethyl este;2-(4-phenylmethoxyphenyl)ethyl decanoate;ecanoic acid, 2-[4-(phenylMethoxy)phenyl]ethyl ester;2-[4-(phenylMethoxy)phenyl]ethyl ester;4-benzyloxyphenylethyl n-decanoate |
| CAS: | 848484-93-5 |
| MF: | C25H34O3 |
| MW: | 382.54 |
| EINECS: | 1592732-453-0 |
| Product Categories: | |
| Mol File: | 848484-93-5.mol |
|
Decanoic acid, 2-[4-(phenylMethoxy)phenyl]ethyl ester Chemical Properties
| Boiling point | 497.4±25.0 °C(Predicted) |
| density | 1.018±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | solid |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C25H34O3/c1-2-3-4-5-6-7-11-14-25(26)27-20-19-22-15-17-24(18-16-22)28-21-23-12-9-8-10-13-23/h8-10,12-13,15-18H,2-7,11,14,19-21H2,1H3 |
| InChIKey | MKSNYWIILLZWOY-UHFFFAOYSA-N |
| SMILES | C(OCCC1=CC=C(OCC2=CC=CC=C2)C=C1)(=O)CCCCCCCCC |
Safety Information
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 4 |
Decanoic acid, 2-[4-(phenylMethoxy)phenyl]ethyl ester Usage And Synthesis
| Uses | Decanoic acid, 2-[4-(phenylMethoxy)phenyl]ethyl ester can be used as a solvent for reversible thermochromic inks and anti-counterfeiting inks |
Decanoic acid, 2-[4-(phenylMethoxy)phenyl]ethyl ester Preparation Products And Raw materials
