Introduction：Basic information about deoxylapachol CAS 3568-90-9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
deoxylapachol Basic information
| Product Name: | deoxylapachol |
| Synonyms: | deoxylapachol;DESOXYLAPACHOL;2-(3-Methyl 2-butenyl)-1,4-naphthoquinone;2-(3-Methyl-2-butenyl)-1,4-naphthoquinone;1,4-Naphthalenedione,2-(3-Methyl-2-buten-1-yl)-;2-(3-methylbut-2-enyl)naphthalene-1,4-dione;1,4-Naphthalenedione, 2-(3-methyl-2-butenyl)-;2-(3-Methylbut-2-en-1-yl)naphthalene-1,4-dione |
| CAS: | 3568-90-9 |
| MF: | C15H14O2 |
| MW: | 226.27 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 3568-90-9.mol |
|
deoxylapachol Chemical Properties
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | oil |
| color | Yellow |
| InChI | InChI=1S/C15H14O2/c1-10(2)7-8-11-9-14(16)12-5-3-4-6-13(12)15(11)17/h3-7,9H,8H2,1-2H3 |
| InChIKey | OSDFYZPKJKRCRR-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=CC=C2)C(=O)C=C1C/C=C(/C)\C |
| LogP | 4.240 (est) |
Safety Information
deoxylapachol Usage And Synthesis
| Description | Deoxylapachol is the main allergen identified in teak (Tectona grandis). Sensitization often concerns people involved in woodwork. |
| Occurrence | deoxylapachol is a natural product found in?Tectona grandis,?Handroanthus impetiginosus, and?other organisms?with data available. |
| Uses | Deoxylapachol is a major cytotoxic component of New Zealand brown alga,Landsburgia quercifolia. Deoxylapachol has antifungal and anti-cancer activity. |
| Definition | ChEBI: 2-demethylmenaquinone is a naphthoquinone and a member of p-quinones. It has a role as an Escherichia coli metabolite. |
| target | Antifection |
deoxylapachol Preparation Products And Raw materials
