Introduction：Basic information about D-Glucal CAS 13265-84-4, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
D-Glucal Basic information
| Product Name: | D-Glucal |
| Synonyms: | D-GLUCAL;(2R,3S,4R)-2-(hydroxymethyl)-3,4-dihydro-2H-pyran-3,4-diol;(2R,4R)-2-(Hydroxymethyl)-3,4-dihydro-2H-pyran-3,4-diol;(2R)-3,4-Dihydro-2α-(hydroxymethyl)-2H-pyran-3β,4α-diol;(2R)-3β,4α-Dihydroxy-3,4-dihydro-2H-pyran-2α-methanol;1,2-Didehydro-1,2-dideoxy-D-glucopyranose;1,5-Anhydro-2-deoxy-D-arabino-hexa-1-enitol;D-Glucal,97% |
| CAS: | 13265-84-4 |
| MF: | C6H10O4 |
| MW: | 146.14 |
| EINECS: | 236-259-3 |
| Product Categories: | 13C & 2H Sugars;Biochemistry;Glucose;Glycals;Sugars;Carbohydrates & Derivatives |
| Mol File: | 13265-84-4.mol |
|
D-Glucal Chemical Properties
| Melting point | 58-60 °C (lit.) |
| Boiling point | 325.5±42.0 °C(Predicted) |
| density | 1.414±0.06 g/cm3(Predicted) |
| refractive index | -10 ° (C=2, H2O) |
| storage temp. | 2-8°C |
| solubility | Soluble in Methanol. |
| pka | 12.79±0.60(Predicted) |
| form | Solid |
| color | White |
| Optical Rotation | [α]21/D 7°, c = 1.9 in H2O |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C6H10O4/c7-3-5-6(9)4(8)1-2-10-5/h1-2,4-9H,3H2/t4-,5-,6+/m1/s1 |
| InChIKey | YVECGMZCTULTIS-PBXRRBTRSA-N |
| SMILES | C1O[C@H](CO)[C@@H](O)[C@H](O)C=1 |
| CAS DataBase Reference | 13265-84-4(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 21-36/38-46-62-63-36/37/38 |
| Safety Statements | 22-24/25-53-36/37-26-25-36 |
| WGK Germany | 3 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
D-Glucal Usage And Synthesis
| Chemical Properties | White to tan solid |
| Uses | D-Glucal is an important building block for both solution- and solid-phase synthesis of oligosaccharides. |
| Uses | It is an important building block for both solution- and solid-phase synthesis of oligosaccharides. |
D-Glucal Preparation Products And Raw materials
| Preparation Products | D-Glucopyranose, 2-azido-2-deoxy-3,4-bis-O-(phenylMethyl)-, 1,6-diacetate-->2-Azido-2-deoxy-D-glucopyranose 1,3,4,6-Tetraacetate-->1,6:2,3-Dianhydro-β-D-mannopyranose-->6-O-(TERT-BUTYLDIPHENYLSILYL)-D-GLUCAL-->D-arabino-Hex-1-enitol, 1,5-anhydro-4,6-O-[bis(1,1-dimethylethyl)silylene]-2-deoxy--->6-O-BENZYL-D-GLUCAL, |
