Introduction:Basic information about Dibenzyl dicarbonate CAS 31139-36-3, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Dibenzyl dicarbonate Basic information
| Product Name: | Dibenzyl dicarbonate |
| Synonyms: | DIBENZYL PYROCARBONATE;DIBENZYL OXYDIFORMATE;DIBENZYL DICARBONATE;PYROCARBONIC ACID DIBENZYL ESTER;Z2O;Dibenzyl dicarbonate 97%;Dibenzyl pyrocarbonate, Z2O;Dibenzyl PyrocarbonatePyrocarbonic Acid Dibenzyl Ester |
| CAS: | 31139-36-3 |
| MF: | C16H14O5 |
| MW: | 286.28 |
| EINECS: | |
| Product Categories: | Biochemistry;Peptide Synthesis;Protection & Derivatization Reagents (for Synthesis);Protective Reagents (Peptide Synthesis);Synthetic Organic Chemistry |
| Mol File: | 31139-36-3.mol |
|
Dibenzyl dicarbonate Chemical Properties
| Melting point | 29-32 °C (lit.) |
| Boiling point | 388.65°C (rough estimate) |
| density | 1.17 g/mL at 25 °C (lit.) |
| refractive index | 1.5000 (estimate) |
| Fp | >230 °F |
| storage temp. | -20°C |
| form | powder to crystal |
| color | White to Almost white |
| BRN | 4324796 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C16H14O5/c17-15(19-11-13-7-3-1-4-8-13)21-16(18)20-12-14-9-5-2-6-10-14/h1-10H,11-12H2 |
| InChIKey | FHRRJZZGSJXPRQ-UHFFFAOYSA-N |
| SMILES | C1(=CC=CC=C1)COC(=O)OC(=O)OCC1C=CC=CC=1 |
| CAS DataBase Reference | 31139-36-3(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 4.4-10-21 |
| HS Code | 29209090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
Dibenzyl dicarbonate Usage And Synthesis
| Uses | Dibenzyl Dicarbonate is a chemical reagent used in the chemical modification of histidine residues in horseradish peroxidase. |
| Synthesis Reference(s) | Tetrahedron Letters, 27, p. 5375, 1986 DOI: 10.1016/S0040-4039(00)85214-4 |
Dibenzyl dicarbonate Preparation Products And Raw materials
| Preparation Products | BENZYL N-(3-HYDROXYPROPYL)CARBAMATE-->Benzyl N-[4-(cyanomethyl)phenyl]carbamate-->TERT-BUTYL-(2S,4R)-N'-(BENZYLOXYCARBONYL)-N'-(BENZYLOXYCARBONYL)-4-HYDROXYORNITHINATE |