Dicyclohexylphenylphosphine CAS 6476-37-5
Introduction：Basic information about Dicyclohexylphenylphosphine CAS 6476-37-5, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Dicyclohexylphenylphosphine Basic information
| Product Name: | Dicyclohexylphenylphosphine |
| Synonyms: | dicyclohexylphenyl-phosphin;phenyldicyclohexylphosphine;Phosphine, dicyclohexylphenyl-;DICYCLOHEXYLPHENYLPHOSPHINE;PHENYLPHOSPHINODICYCLOHEXANE;Dicyclohexyphenylphosphine;PHENYLDICYCLOHEXYLPHOSPHINE(PHPCY2);dicyclohexylphenylphosphine95+% |
| CAS: | 6476-37-5 |
| MF: | C18H27P |
| MW: | 274.38 |
| EINECS: | 229-334-7 |
| Product Categories: | Achiral Phosphine;Aryl Phosphine;Mitsunobu Reaction;Phosphine Ligands;Phosphines (Mitsunobu Reaction);Synthetic Organic Chemistry;Catalysis and Inorganic Chemistry;Phosphine Ligands;Phosphorus Compounds |
| Mol File: | 6476-37-5.mol |
Dicyclohexylphenylphosphine Chemical Properties
| Melting point | 60-61 °C (lit.) |
| Boiling point | 391.8±11.0 °C(Predicted) |
| storage temp. | 2-8°C, protect from light, stored under nitrogen |
| form | Crystalline Powder |
| color | White to off-white |
| Water Solubility | Insoluble in water. |
| Sensitive | Air Sensitive |
| InChI | InChI=1S/C18H27P/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1,4-5,10-11,17-18H,2-3,6-9,12-15H2 |
| InChIKey | VPLLTGLLUHLIHA-UHFFFAOYSA-N |
| SMILES | P(C1CCCCC1)(C1CCCCC1)C1=CC=CC=C1 |
| CAS DataBase Reference | 6476-37-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Dicyclohexylphenylphosphine(6476-37-5) |
| EPA Substance Registry System | Phosphine, dicyclohexylphenyl- (6476-37-5) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 36 |
| WGK Germany | 3 |
| RTECS | SY9125000 |
| TSCA | TSCA listed |
| HS Code | 29310099 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
| Chemical Properties | White to off-white crystalline powder |
| Uses | Dicyclohexylphenylphosphine ?is an organic phosphine compound, which can be used as a raw material for organic synthesis. |
| reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling reagent type: ligand |
| Properties and Applications | The key properties of dicyclohexylphenylphosphine lie in its substantial steric hindrance (provided by the two cyclohexyl groups) and strong electron-donating ability (contributed by both the phenyl and cyclohexyl groups). These properties make the metal catalysts (particularly palladium catalysts) formed with it highly active and stable, effectively promoting the synthesis of complex molecules. |
Dicyclohexylphenylphosphine Preparation Products And Raw materials
| Raw materials | Diethyl ether-->Nitrogen-->Magnesium-->Chlorocyclohexane-->Dichlorophenylphosphine-->Cyclohexyldiphenylphosphine |
| Preparation Products | DI-TERT-BUTYLPHENYLPHOSPHINE |
