Introduction：Basic information about DIETHYL ETHER-D10 CAS 2679-89-2, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
DIETHYL ETHER-D10 Basic information
| Product Name: | DIETHYL ETHER-D10 |
| Synonyms: | DIETHYL-D10 ETHER;DIETHYL ETHER-D10;ETHYL ETHER (D10);ETHYL-D5 ETHER;ETHER-D10;2,2'-oxybis[[2H5]ethane];DIETHYL ETHER-D10 DEUTERATION DEGREE MI&;Ether-d10, 99 atom % D |
| CAS: | 2679-89-2 |
| MF: | C4D10O |
| MW: | 84.18 |
| EINECS: | 220-235-4 |
| Product Categories: | |
| Mol File: | 2679-89-2.mol |
|
DIETHYL ETHER-D10 Chemical Properties
| Melting point | -116 °C(lit.) |
| Boiling point | 33-34 °C(lit.) |
| density | 0.801 g/mL at 25 °C |
| refractive index | 1.351-1.353 |
| Fp | -40 °F |
| storage temp. | 0-6°C |
| solubility | 69g/l |
| form | Liquid |
| color | Colorless |
| explosive limit | 1.7-36%(V) |
| InChI | 1S/C4H10O/c1-3-5-4-2/h3-4H2,1-2H3/i1D3,2D3,3D2,4D2 |
| InChIKey | RTZKZFJDLAIYFH-MWUKXHIBSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])OC([2H])([2H])C([2H])([2H])[2H] |
| EPA Substance Registry System | Diethyl ether-d10 (2679-89-2) |
Safety Information
| Hazard Codes | F+,Xn |
| Risk Statements | 12-19-22-66-67 |
| Safety Statements | 9-16-29-33 |
| RIDADR | UN 1155 3/PG 1 |
| WGK Germany | 1 |
| HazardClass | 3 |
| PackingGroup | I |
| HS Code | 28459000 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Oral
Flam. Liq. 1
STOT SE 3 |
DIETHYL ETHER-D10 Usage And Synthesis
| Chemical Properties | clear colorless liquid |
| Uses | Ether-d10 (Diethyl ether-d10) may be used as an NMR solvent to propose the structure for [4-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2,3,3-trimethyl-1-(trimethylsilyl)butyl]lithium based on the NMR data. |
| General Description | Ether-d10 is a deuterated NMR solvent useful in NMR-based research and analyses. |
DIETHYL ETHER-D10 Preparation Products And Raw materials
| Preparation Products | ETHYLENE-D4 |
