Introduction：Basic information about Diethylene glycol dibenzoate CAS 120-55-8, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Diethylene glycol dibenzoate Basic information
| Product Name: | Diethylene glycol dibenzoate |
| Synonyms: | OXY BIS(2-ETHYL BENZOATE);DIGLYCOL DIBENZOATE;DIETHYLENE GLYCOL DIBENZOATE;DEGDB;2,2'-oxydiethylene dibenzoate;2,2-OXYBISETHANOLDIBENZOATE;Reaktionsprodukt aus Diethylenglykol mit Benzoesure;diethylenebenzylbenzoate |
| CAS: | 120-55-8 |
| MF: | C18H18O5 |
| MW: | 314.33 |
| EINECS: | 204-407-6 |
| Product Categories: | Functional Materials;Plasticizer;Polyalcohol Ethers, Esters (Plasticizer);Plasticizers;Polymer Additives;Polymer Science |
| Mol File: | 120-55-8.mol |
|
Diethylene glycol dibenzoate Chemical Properties
| Melting point | 24°C |
| Boiling point | 235-237 °C7 mm Hg(lit.) |
| density | 1.175 g/mL at 25 °C(lit.) |
| vapor pressure | 0Pa at 25℃ |
| refractive index | n20/D 1.544(lit.) |
| Fp | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | Oil |
| color | Clear Colourless |
| Water Solubility | 38.3mg/L at 20℃ |
| Cosmetics Ingredients Functions | PLASTICISER
SKIN CONDITIONING - EMOLLIENT
HAIR CONDITIONING |
| InChI | 1S/C18H18O5/c19-17(15-7-3-1-4-8-15)22-13-11-21-12-14-23-18(20)16-9-5-2-6-10-16/h1-10H,11-14H2 |
| InChIKey | NXQMCAOPTPLPRL-UHFFFAOYSA-N |
| SMILES | O=C(OCCOCCOC(=O)c1ccccc1)c2ccccc2 |
| LogP | 3.2 at 30℃ |
| CAS DataBase Reference | 120-55-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Ethanol, 2,2'-oxybis-, dibenzoate(120-55-8) |
| EPA Substance Registry System | Diethylene glycol dibenzoate (120-55-8) |
Safety Information
| Safety Statements | 24/25 |
| WGK Germany | 2 |
| RTECS | ID6650000 |
| TSCA | TSCA listed |
| HS Code | 29163100 |
| Storage Class | 10 - Combustible liquids |
| Hazardous Substances Data | 120-55-8(Hazardous Substances Data) |
Diethylene glycol dibenzoate Usage And Synthesis
| Uses | Diethylene Glycol Dibenzoate is used in analytical studies to investigation into the migration potential of coating materials from cookware products. |
| General Description | Di(ethylene glycol) dibenzoate (DEGDB) is a widely used dibenzoate ester based plasticizer, which has either linkages at the center that connect the two benzoate groups. |
Diethylene glycol dibenzoate Preparation Products And Raw materials
| Raw materials | Diethylene glycol |
