Introduction:Basic information about Diisobutyl fumarate CAS 7283-69-4, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Diisobutyl fumarate Basic information
| Product Name: | Diisobutyl fumarate |
| Synonyms: | 2-Butenedioic acid (E)-, bis(2-methylpropyl) ester;Diisobutyl (2E)-2-butenedioate;Diisobutylester kyseliny fumarove;diisobutylesterkyselinyfumarove;Fumaric acid, diisobutyl ester;fumaricacid,diisobutylester;fumaricacidbis-(2-methylpropyl)ester;DIISOBUTYL FUMARATE |
| CAS: | 7283-69-4 |
| MF: | C12H20O4 |
| MW: | 228.28 |
| EINECS: | 230-706-6 |
| Product Categories: | Plasticizers;Polymer Additives;Polymer Science |
| Mol File: | 7283-69-4.mol |
|
Diisobutyl fumarate Chemical Properties
| Melting point | 8 °C(lit.) |
| Boiling point | 249 °C(lit.) |
| density | 0.978 g/mL at 25 °C(lit.) |
| refractive index | n20/D 1.443(lit.) |
| Fp | >230 °F |
| storage temp. | 2-30°C |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 0.974~0.980 (20/4℃) |
| InChI | 1S/C12H20O4/c1-9(2)7-15-11(13)5-6-12(14)16-8-10(3)4/h5-6,9-10H,7-8H2,1-4H3/b6-5+ |
| InChIKey | RSRICHZMFPHXLE-AATRIKPKSA-N |
| SMILES | CC(C)COC(=O)\C=C\C(=O)OCC(C)C |
| NIST Chemistry Reference | Diisobutylfomarate(7283-69-4) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 38 |
| Safety Statements | 24-26-36 |
| WGK Germany | 3 |
| RTECS | LT1565000 |
| HS Code | 2917.19.1700 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Skin Irrit. 2 |
Diisobutyl fumarate Usage And Synthesis
| Uses | Diisobutyl Fumarate is used in preparation of functional mixed plasticizer by variable pressure esterification. |
Diisobutyl fumarate Preparation Products And Raw materials