Introduction：Basic information about Diisooctyl sebacate CAS 27214-90-0, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Diisooctyl sebacate Basic information
| Product Name: | Diisooctyl sebacate |
| Synonyms: | Decanedioic acid, 1,10-diisooctyl ester;13/5000 Isooctyl stearate EHMS;di-n-octyl decanedioate;SEBACICACID,BIS(6-METHYLHEPTYL)ESTER;BIS(6-METHYLHEPTYL)SEBACATE;Diisooctyl sebacate;Sebacic acid diisooctyl ester;Isooctyl octadecanoate |
| CAS: | 27214-90-0 |
| MF: | C26H50O4 |
| MW: | 426.67 |
| EINECS: | 2483332 |
| Product Categories: | Fatty Acid Esters (Plasticizer);Functional Materials;Plasticizer;bc0001 |
| Mol File: | 27214-90-0.mol |
|
Diisooctyl sebacate Chemical Properties
| Boiling point | 225 °C / 2mmHg |
| density | 0,91 g/cm3 |
| Fp | 215°C |
| storage temp. | 2-8°C |
| Appearance | Colorless to light yellow Liquid |
| Cosmetic Ingredient Review (CIR) | Diisooctyl sebacate (27214-90-0) |
| InChI | InChI=1S/C26H50O4/c1-23(2)17-11-9-15-21-29-25(27)19-13-7-5-6-8-14-20-26(28)30-22-16-10-12-18-24(3)4/h23-24H,5-22H2,1-4H3 |
| InChIKey | ZWYAVGUHWPLBGT-UHFFFAOYSA-N |
| SMILES | C(OCCCCCC(C)C)(=O)CCCCCCCCC(OCCCCCC(C)C)=O |
| LogP | 9.722 (est) |
| CAS DataBase Reference | 27214-90-0(CAS DataBase Reference) |
| EPA Substance Registry System | Decanedioic acid, diisooctyl ester (27214-90-0) |
Safety Information
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| TSCA | TSCA listed |
Diisooctyl sebacate Usage And Synthesis
| Uses | Diisooctyl sebacate is an excellent low-temperature resistant plasticizer often used in the technical fields of plasticizing applications for polyvinyl chloride cable materials, cold-resistant films, artificial leather, and other resins. At the same time, it is also essential as a base oil for biomass-based lubricants. This base oil can be used as a base oil for jet engine lubricants due to its high-temperature resistance, low-temperature resistance, degradability, and other characteristics. |
Diisooctyl sebacate Preparation Products And Raw materials
| Raw materials | 1-Octanol-->2-Ethylhexanol-->Sebacic acid-->Decanoic acid |
