Dimethyl 4-(2-Chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate CAS 43067-01-2
Introduction：Basic information about Dimethyl 4-(2-Chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate CAS 43067-01-2, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Dimethyl 4-(2-Chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate Basic information
| Product Name: | Dimethyl 4-(2-Chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| Synonyms: | Dimethyl 4-(2-Chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate;4-(2-Chlorophenyl)-1,4-dihydro-2,6-dimethyl-3,5-pyridinedicarboxylic acid dimethyl ester;4-(2-Chlorophenyl)-1,4-dihydro-2,6-diMethyl-3,5-pyridinedicarboxylic Acid 3,5-DiMethyl Ester;4-(2-Chlorophenyl)-3,5-di(Methoxycarbonyl)-2,6-diMethyl-1,4-dihydropyridine;AMlodipine IMpurity G (EP);AMlodipine EP IMpurity G;dimethyl 4-(2-chlorophenyl);Amlodipine Besylate Impurity G |
| CAS: | 43067-01-2 |
| MF: | C17H18ClNO4 |
| MW: | 335.78 |
| EINECS: | |
| Product Categories: | Aromatics;Heterocycles;Intermediates;Intermediates & Fine Chemicals;Pharmaceuticals |
| Mol File: | 43067-01-2.mol |
Dimethyl 4-(2-Chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate Chemical Properties
| Melting point | 196-198℃ |
| Boiling point | 436.7±45.0 °C(Predicted) |
| density | 1.232±0.06 g/cm3(Predicted) |
| storage temp. | Refrigerator |
| solubility | Chloroform (Slightly), Dichloromethane (Slightly), DMSO (Slightly) |
| form | Solid |
| pka | 2.79±0.70(Predicted) |
| color | Off-White to Pale Yellow |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C17H18ClNO4/c1-9-13(16(20)22-3)15(11-7-5-6-8-12(11)18)14(10(2)19-9)17(21)23-4/h5-8,15,19H,1-4H3 |
| InChIKey | REIGLQUFMMOAFU-UHFFFAOYSA-N |
| SMILES | O=C(OC)C1=C(C)NC(C)=C(C(OC)=O)C1C2=C(Cl)C=CC=C2 |
Safety Information
| WGK Germany | WGK 3 |
| HS Code | 2933399090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Uses | Dimethyl 4-(2-Chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate (Amlodipine EP Impurity G) is an Amlodipine Besilate (A633500) impurity. |
| Uses | Amlodipine Besilate (A633500) impurity. |
Dimethyl 4-(2-Chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate Preparation Products And Raw materials
