Introduction：Basic information about Diosgenin glucoside CAS 14144-06-0, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Diosgenin glucoside Basic information
| Product Name: | Diosgenin glucoside |
| Synonyms: | diosgeninglucoside;TRILLIN;Disogluside;(25R)-3β-(β-D-Glucopyranosyloxy)spirost-5-ene;[(25R)-Spirost-5-en-3β-yl]β-D-glucopyranoside;Diosgenin 3-glucoside;Prosapogenin D'3;(25R)-3b-(beta-D-Glucopyranosyloxy)spirost-5-ene |
| CAS: | 14144-06-0 |
| MF: | C33H52O8 |
| MW: | 576.76 |
| EINECS: | |
| Product Categories: | chemical reagent;pharmaceutical intermediate;phytochemical;reference standards from Chinese medicinal herbs (TCM).;standardized herbal extract |
| Mol File: | 14144-06-0.mol |
|
Diosgenin glucoside Chemical Properties
| Melting point | 275～280℃ |
| Boiling point | 705.1±60.0 °C(Predicted) |
| density | 1.27±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMF:1.0(Max Conc. mg/mL);1.73(Max Conc. mM)
DMSO:63.0(Max Conc. mg/mL);109.23(Max Conc. mM)
DMSO:PBS (pH 7.2) (1:2):0.33(Max Conc. mg/mL);0.57(Max Conc. mM) |
| form | A solid |
| pka | 12.91±0.70(Predicted) |
| color | White to off-white |
| Major Application | food and beverages |
| InChIKey | WXMARHKAXWRNDM-DAOPZNMBNA-N |
| SMILES | O1[C@H]([C@@H]([C@H]([C@@H]([C@H]1CO)O)O)O)OC2CC[C@@]3([C@@H]4[C@H]([C@H]5[C@@]([C@@H]6[C@@H](O[C@@]7(OC[C@@H](CC7)C)[C@H]6C)C5)(CC4)C)CC=C3C2)C |
Safety Information
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
Diosgenin glucoside Usage And Synthesis
| Chemical Properties | White powder, soluble in organic solvents such as methanol, ethanol, DMSO, etc., derived from Trillium, Solanum lycopersicum. |
| Uses | Polyphyllin A can be useful in computational NMR and molecular docking scrutiny of potential natural SARS-CoV-2 Mpro inhibitors. |
| Definition | ChEBI: A sterol 3-beta-D-glucoside having diosgenin as the sterol component. |
Diosgenin glucoside Preparation Products And Raw materials
