Introduction:Basic information about DI-TERT-BUTYLSILANE CAS 30736-07-3, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
DI-TERT-BUTYLSILANE Basic information
| Product Name: | DI-TERT-BUTYLSILANE |
| Synonyms: | DI-T-BUTYL SILANE;Ditertiarybutylsilane;Di-tert-butylsilane 97%;bis(1,1-dimethylethyl)-silan;DI-TERT-BUTYLSILANE;Di-tert-Butylsilane>Silane, bis(1,1-dimethylethyl)-;Di-tert-butylsilane |
| CAS: | 30736-07-3 |
| MF: | C8H20Si |
| MW: | 144.33 |
| EINECS: | |
| Product Categories: | Chemical Synthesis;Organometallic Reagents;Si (Classes of Silicon Compounds);Si-H Compounds;Organometallic Reagents;Organosilicon;Others |
| Mol File: | 30736-07-3.mol |
|
DI-TERT-BUTYLSILANE Chemical Properties
| Melting point | -38 °C (lit.) |
| Boiling point | 129-130 °C (lit.) |
| density | 0.729 g/mL at 25 °C (lit.) |
| refractive index | n20/D 1.42(lit.) |
| Fp | 28 °F |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 0.74 |
| Hydrolytic Sensitivity | 3: reacts with aqueous base |
| InChI | 1S/C8H20Si/c1-7(2,3)9-8(4,5)6/h9H2,1-6H3 |
| InChIKey | ZLKSBZCITVUTSN-UHFFFAOYSA-N |
| SMILES | [H][Si]([H])(C(C)(C)C)C(C)(C)C |
| CAS DataBase Reference | 30736-07-3(CAS DataBase Reference) |
| EPA Substance Registry System | Silane, bis(1,1-dimethylethyl)- (30736-07-3) |
Safety Information
| Hazard Codes | F |
| Risk Statements | 11 |
| Safety Statements | 16-33 |
| RIDADR | UN 1993 3/PG 1 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 2931.90.9010 |
| HazardClass | 3 |
| PackingGroup | II |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 2 |
DI-TERT-BUTYLSILANE Usage And Synthesis
| Uses | Di-tert-butylsilane can be used as a reagent to synthesize:
- 1,1-di-tert-butyl-N-phenylsilanamine by dehydrogenative coupling with aniline in the presence of supported gold catalyst.
- Benzyloxy di-tert-butylsilane by dehydrocoupling of benzyl alcohol using NaOH as a catalyst.
- Di-tert-butyl(3-cyclohexylprop-1-yn-1-yl)silane by silylation reaction with 2-propyn-1-ylcyclohexane using alkali metal hydroxide as a catalyst.
|
| Application | Sterically-hindered silane reducing agent. |
DI-TERT-BUTYLSILANE Preparation Products And Raw materials