Introduction:Basic information about DL-Lysine acetylsalicylate CAS 62952-06-1, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
DL-Lysine acetylsalicylate Basic information
| Product Name: | DL-Lysine acetylsalicylate |
| Synonyms: | LYSINE ACETYLSALICYLIC ACID;LYSINE ACETYLSALICYLATE;DL-LYSINE ACETYLSALICYLATE;aspirin dl-lysine;2-(Acetyloxy)benzoate;Aspirin-D L-Lysine for Injection;Lysine, 2-(acetyloxy)benzoate (1:1);Lysine, monosalicylate acetate (ester), D |
| CAS: | 62952-06-1 |
| MF: | C9H8O4.C6H14N2O2 |
| MW: | 326.35 |
| EINECS: | 263-769-3 |
| Product Categories: | Aromatics;Intermediates & Fine Chemicals;Pharmaceuticals |
| Mol File: | 62952-06-1.mol |
|
DL-Lysine acetylsalicylate Chemical Properties
| Melting point | 154-156°C |
| Boiling point | 464.39°C (rough estimate) |
| density | 1.1829 (rough estimate) |
| refractive index | 1.6280 (estimate) |
| storage temp. | -20°C Freezer |
| solubility | Methanol (Slightly), Water (Slightly) |
| form | Solid |
| color | White |
| InChI | InChI=1S/C9H8O4.C6H14N2O2/c1-6(10)13-8-5-3-2-4-7(8)9(11)12;7-4-2-1-3-5(8)6(9)10/h2-5H,1H3,(H,11,12);5H,1-4,7-8H2,(H,9,10) |
| InChIKey | JJBCTCGUOQYZHK-UHFFFAOYSA-N |
| SMILES | C(N)(C(=O)O)CCCCN.C(C1C=CC=CC=1OC(=O)C)(=O)O |
| CAS DataBase Reference | 62952-06-1(CAS DataBase Reference) |
| EPA Substance Registry System | Aspirin DL-lysine (62952-06-1) |
Safety Information
| WGK Germany | WGK 3 |
| TSCA | TSCA listed |
| Storage Class | 11 - Combustible Solids |
| Toxicity | LD50 orl-rat: 4350 mg/kg IYKEDH 13,1128,82 |
DL-Lysine acetylsalicylate Usage And Synthesis
| Chemical Properties | Crystalline Solid |
| Uses | Non-steroidal anti-inflammatory drugs (NSAIDs) may inhibit cancer growth. Water soluble, injectable aspirin derivative.Analgesic; antipyretic; anti-inflammatory. |
| Safety Profile | Moderately toxic by ingestion andother routes. When heated to decomposition it emits toxicfumes of NOx. |
DL-Lysine acetylsalicylate Preparation Products And Raw materials