Introduction：Basic information about DL-Tryptophan CAS 54-12-6, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
DL-Tryptophan Basic information
| Product Name: | DL-Tryptophan |
| Synonyms: | (rs)-tryptophan;2-Amino-3,3’-IndolylpropanoicAcid;DL-Trytophan;DL-Trytophane;DL-TRYPTOPHAN extrapure CHR;(±)-α-Amino-3-indolepropionic acid, (±)-2-Amino-3-(3-indolyl)propionic acid, DL-3β-Indolylalanine;α-amino-β-indolepropinic acid;DL-Tryptoplaan |
| CAS: | 54-12-6 |
| MF: | C11H12N2O2 |
| MW: | 204.23 |
| EINECS: | 200-194-9 |
| Product Categories: | Amino Acids & Derivatives;Tryptophan [Trp, W];alpha-Amino Acids;Amino Acids;Biochemistry;Indoles;Tryptophans;Amino Acids;Alphabetical Listings;Stable Isotopes;Amino Acids Derivatives |
| Mol File: | 54-12-6.mol |
|
DL-Tryptophan Chemical Properties
| Melting point | 289-290 °C (dec.)(lit.) |
| alpha | [α]D20 -1～1°(c=1, dil. HCl) |
| Boiling point | 342.72°C (rough estimate) |
| density | 1.1754 (rough estimate) |
| refractive index | 1.5200 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | methanol: water (7:3): soluble |
| pka | 2.30±0.10(Predicted) |
| form | Powder |
| color | White to light beige or light yellow |
| Odor | Odorless |
| Water Solubility | 10 g/L (20 ºC) |
| BRN | 86196 |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong acids. |
| Cosmetics Ingredients Functions | ANTISTATIC
HAIR CONDITIONING
FRAGRANCE |
| InChI | 1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15) |
| InChIKey | QIVBCDIJIAJPQS-UHFFFAOYSA-N |
| SMILES | NC(Cc1c[nH]c2ccccc12)C(O)=O |
| LogP | 1.040 (est) |
| CAS DataBase Reference | 54-12-6(CAS DataBase Reference) |
| NIST Chemistry Reference | Tryptophane(54-12-6) |
| EPA Substance Registry System | Tryptophan (54-12-6) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 22-36/37/38-37/38-41 |
| Safety Statements | 24/25-36/37/39-36-26 |
| WGK Germany | 1 |
| RTECS | YN6129200 |
| F | 8 |
| TSCA | TSCA listed |
| HS Code | 29339990 |
| Storage Class | 11 - Combustible Solids |
DL-Tryptophan Usage And Synthesis
| Chemical Properties | White crystals. Slightly soluble inwater; stable in alkaline solution; decomposed bystrong acids. |
| Uses | DL-Tryptophan is an amino acid precursor of serotonin and melatonin. It is a dietary supplement for use as an antidepressant, anxiolytic, and sleep aid. DL-tryptophan also can be used as feed nutrition enhancer, antioxidants. |
| Definition | ChEBI: An alpha-amino acid that is alanine bearing an indol-3-yl substituent at position 3. |
| General Description | Tryptophan is the precursor for 5-hydroxy-tryptamin and an essential α-amino acid. DL-Tryptophan exists as a zwitterion during crystallization. |
| reaction suitability | reaction type: solution phase peptide synthesis |
| Biochem/physiol Actions | DL-Tryptophan binding to bovine serum albumin is employed for its affinity based chromatographic purification. Supplementation of tryptophan in diets of rat induce bladder tumor. |
| Safety Profile | Experimentalreproductive effects. Questionablecarcinogen with experimental carcinogenicdata. When heated to decomposition itemits toxic fumes of NOx. |
DL-Tryptophan Preparation Products And Raw materials
| Raw materials | Acetic acid-->Sodium sulfate-->Acetic anhydride-->Water-->Dimethylamine-->Acrolein-->Starch-->Pyruvic acid-->Sulfurous Acid-->formaldehyde-->Indole-->L-Alanine-->L-Phenylalanine-->1-Cyclopropyl-6,7-difluoro-1,4-dihydro-8-methoxy-4-oxo-3-quinolinecarboxylic acid ethyl ester-->Inosine-->L-Tyrosine-->L-Tryptophan-->DL-Serine-->2-Methylindole-->N-[(tert-Butoxy)carbonyl]-D-tryptophan-->Gramine-->INDOPHENOL-->2-Acetamidoacrylic acid-->Pyridoxal 5'-phosphate monohydrate-->AMINOMALONIC ACID |
| Preparation Products | L-Tryptophan-->D-Tryptophan |
