Introduction：Basic information about ENDO-NORBORNEOL CAS 497-36-9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
ENDO-NORBORNEOL Basic information
| Product Name: | ENDO-NORBORNEOL |
| Synonyms: | ENDO-NORBORNEOL;ENDO-(+/-)-2-NORBORNANOL;endo-bicyclo[2.2.1]heptan-2-ol;rel-(1α*,4α*)-Bicyclo[2.2.1]heptane-2β*-ol;endo-(±)-Norborneol,92%;endo-(±:)-Norborneol;endo-(§1)-Norborneol, 92%;rel-(1R,3R,4S)-bicyclo[2.2.1]heptan-3-ol |
| CAS: | 497-36-9 |
| MF: | C7H12O |
| MW: | 112.17 |
| EINECS: | 207-844-0 |
| Product Categories: | |
| Mol File: | 497-36-9.mol |
|
ENDO-NORBORNEOL Chemical Properties
| Melting point | 149-151 °C(lit.) |
| Boiling point | 176.5±0.0℃ (760 Torr) |
| density | 1.097±0.06 g/cm3 (20 ºC 760 Torr) |
| refractive index | 1.4460 (estimate) |
| Fp | 74.4±10.9℃ |
| form | powder |
| pka | 15.31±0.20(Predicted) |
| InChI | 1S/C7H12O/c8-7-4-5-1-2-6(7)3-5/h5-8H,1-4H2/t5-,6+,7-/m0/s1 |
| InChIKey | ZQTYQMYDIHMKQB-XVMARJQXSA-N |
| SMILES | O[C@@H]1[C@H]2C[C@H](CC2)C1 |
Safety Information
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29061900 |
| Storage Class | 11 - Combustible Solids |
ENDO-NORBORNEOL Usage And Synthesis
| Chemical Properties | light yellow-beige adhering crystals or powder |
ENDO-NORBORNEOL Preparation Products And Raw materials
| Preparation Products | NORCAMPHOR |
