ergosterol-5,8-peroxide CAS 2061-64-5
Introduction:Basic information about ergosterol-5,8-peroxide CAS 2061-64-5, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
ergosterol-5,8-peroxide Basic information
| Product Name: | ergosterol-5,8-peroxide |
| Synonyms: | Ergosterol peroxide;(22E)-5α,8α-Epidioxy-5α-ergosta-6,22-dien-3β-ol;(22E)-5α,8α-Epidioxyergosta-6,22-diene-3β-ol;Ergosterol 5α,8α-epidioxide;Ergosterol endoperoxide;Peroxyergosterol;ergosterol-5,8-peroxide;Ergosta-6,22-dien-3-ol,5,8-epidioxy-, (3b,5a,8a,22E)- |
| CAS: | 2061-64-5 |
| MF: | C28H44O3 |
| MW: | 428.65 |
| EINECS: | |
| Product Categories: | Steroids |
| Mol File: | 2061-64-5.mol |
ergosterol-5,8-peroxide Chemical Properties
| Melting point | 178 °C |
| Boiling point | 499.7±45.0 °C(Predicted) |
| density | 1.08±0.1 g/cm3(Predicted) |
| storage temp. | Store at -20°C |
| solubility | Methanol: soluble |
| form | Powder |
| pka | 14.97±0.70(Predicted) |
| color | White to off-white |
| Cosmetics Ingredients Functions | BLEACHING SKIN CONDITIONING HUMECTANT |
| InChIKey | LXIJTUMNXIROPP-LJJIWTQONA-N |
| SMILES | [C@@]123OO[C@@]4(C[C@@H](O)CC[C@]4(C)[C@@]1([H])CC[C@]1(C)[C@@](CC[C@@]21[H])(O)[C@H](C)/C=C/[C@H](C)C(C)C)C=C3 |&1:0,3,5,9,11,15,17,20,23,27,r| |
Safety Information
| Uses | Network pharmacology and molecular docking study on inhibition of Mpro, primary protease of COVID-19, by Poria cocos and its active compounds. |
| Definition | ChEBI: Ergosterol peroxide is an ergostanoid that is ergosta-6,22-dien-3-ol with a peroxy group between positions 5 and 8 (the 3beta,5alpha,8alpha,22E stereoisomer). Isolated from Ganoderma lucidum and Cordyceps sinensis, it exhibits antimycobacterial, trypanocidal and antineoplastic activities. It has a role as a metabolite, an antineoplastic agent, an antimycobacterial drug and a trypanocidal drug. It is an organic peroxide, an ergostanoid, a 3beta-sterol and a member of phytosterols. It is functionally related to an ergosterol. |
