Introduction：Basic information about Fluorescent Brightener 367 CAS 5089-22-5, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Fluorescent Brightener 367 Basic information
| Product Name: | Fluorescent Brightener 367 |
| Synonyms: | 2,2’-(1,4-naphthalenediyl)bis-benzoxazol;Fluorescent Brightener 367;Fluorescent Brightener KCB;KCB;Optical Brightening Agent KCB C. I. 367;DIBENZOXAZOYL NAPHTHALENE;1,4-BIS(BENZOXAZOLYL-2-YL)NAPHTHALENE;1,4-BIS-BENZOXAZOLYL-NAPHTHALENE |
| CAS: | 5089-22-5 |
| MF: | C24H14N2O2 |
| MW: | 362.38 |
| EINECS: | 225-803-5 |
| Product Categories: | brightener;Industrial/Fine Chemicals |
| Mol File: | 5089-22-5.mol |
|
Fluorescent Brightener 367 Chemical Properties
| Melting point | 210-212°C |
| Boiling point | 521.9±33.0 °C(Predicted) |
| density | 1.320±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 1.24±0.10(Predicted) |
| form | powder to crystal |
| color | Light yellow to Amber to Dark green |
| Water Solubility | insoluble |
| InChI | InChI=1S/C24H14N2O2/c1-2-8-16-15(7-1)17(23-25-19-9-3-5-11-21(19)27-23)13-14-18(16)24-26-20-10-4-6-12-22(20)28-24/h1-14H |
| InChIKey | WFYSPVCBIJCZPX-UHFFFAOYSA-N |
| SMILES | C1(C2=NC3=CC=CC=C3O2)=C2C(C=CC=C2)=C(C2=NC3=CC=CC=C3O2)C=C1 |
| LogP | 7.57 at 25℃ |
| CAS DataBase Reference | 5089-22-5(CAS DataBase Reference) |
| EPA Substance Registry System | Benzoxazole, 2,2'-(1,4-naphthalenediyl)bis- (5089-22-5) |
Safety Information
| TSCA | TSCA listed |
| HS Code | 3204200090 |
Fluorescent Brightener 367 Usage And Synthesis
| Chemical Properties | Fluorescent whitening agent 367 is yellowish green crystalline powder, non-toxic and tasteless, insoluble in water, soluble in acetone, carbon tetrachloride, dimethylmethylcoolamine, trimethylbenzene, polyvinyl chloride and toluene, slightly soluble in ethanol, isopropanol and methanol. The maximum absorption wavelength is 370nm, the maximum fluorescence emission wavelength is 437nm, excellent light and heat resistance, good chemical stability, does not react with foaming agent cross-linking agent, good compatibility with macromolecules, no exudation phenomenon. |
| Flammability and Explosibility | Not classified |
| Properties and Applications | | TEST ITEMS | SPECIFICATION | | APPEARANCE | BRIGHT GREEN CRYSTALLINE POWDER | | SHADE | BRIGHT BLUISH | | METLING POINT | 210-212 ° C | | PURITY | 99% min | | FINENESS | 300 mesh min | | MAX UV ABSORPTION | 370mm | |
Fluorescent Brightener 367 Preparation Products And Raw materials
| Raw materials | 2-Aminophenol |
