Introduction：Basic information about CAS 3326-35-0|4-Nitrofluorescein, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Nitrofluorescein |
|---|
| CAS Number | 3326-35-0 | Molecular Weight | 377.304 |
|---|
| Density | 1.7±0.1 g/cm3 | Boiling Point | 694.9±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C20H11NO7 | Melting Point | >300ºC |
|---|
| MSDS | / | Flash Point | 374.1±31.5 °C |
|---|
Names
| Name | Nitrofluorescein, Isomer 1 |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.7±0.1 g/cm3 |
|---|
| Boiling Point | 694.9±55.0 °C at 760 mmHg |
|---|
| Melting Point | >300ºC |
|---|
| Molecular Formula | C20H11NO7 |
|---|
| Molecular Weight | 377.304 |
|---|
| Flash Point | 374.1±31.5 °C |
|---|
| Exact Mass | 377.053558 |
|---|
| PSA | 121.81000 |
|---|
| LogP | 2.44 |
|---|
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.807 |
|---|
| InChIKey | UACQOMKZFGNRBL-UHFFFAOYSA-N |
|---|
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])C(=O)OC23C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2932999099 |
|---|
Customs
| HS Code | 2932999099 |
|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 5'-nitrofluorescein |
| 3',6'-Dihydroxy-4-nitro-3H-spiro[2-benzofuran-1,9'-xanthen]-3-one |
| 3',6'-dihydroxy-6-nitro-spiro[isobenzofuran-3,9'-xanthene]-1-one |
| 4-NITROFLUOROESCEIN |
| 3',6'-dihydroxy-5-nitro-spiro[phthalan-1,9'-xanthen]-3-one |
| 5-Nitro-3',6'-dihydroxyspiro[isobenzofuran-1(3H),9'-[9H]xanthene]-3-one |
| 3',6'-dihydroxy-5-nitrospiro[2-benzofuran-3,9'-xanthene]-1-one |
| Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 3',6'-dihydroxy-4-nitro- |
| 3',6'-Dihydroxy-5-nitro-spiro[phthalan-1,9'-xanthen]-3-on |
| 5-Nitrofluorescein (isomer I) |
| 5-NITRO-3',6'-DIHYDROXYSPIRO[ISOBENZOFURAN-1(3H),9'-(9H)XANTHEN]-3-ONE |
| 3',6'-Dihydroxy-5-nitrospiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one |
| 3',6'-dihydroxy-6-nitrospiro[2-benzofuran-3,9'-xanthene]-1-one |
| 4-Nitrofluorescein |
