Geniposidic acid CAS 27741-01-1
Introduction：Basic information about Geniposidic acid CAS 27741-01-1, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Geniposidic acid Basic information
| Product Name: | Geniposidic acid |
| Synonyms: | (1S,4aS,7aS)-7-(hydroxymethyl)-1-((2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-tetrahydro-2H-pyran-2-yloxy)-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylic acid;(1R,2S,6S)-9-(Hydroxymethyl)-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3-oxabicyclo[4.3.0]nona-4,8-diene-5-carboxylic acid;GENIPOSIDIC ACID;Geniposidic acid std.;(1S)-1α-(β-D-Glucopyranosyloxy)-1,4aα,5,7aα-tetrahydro-7-hydroxymethylcyclopenta[c]pyran-4-carboxylic acid;(1S,4aS,7aS)-7-(Hydroxymethyl)-1-(β-D-glucopyranosyloxy)-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylic acid;1α-(β-D-Glucopyranosyloxy)-1,4aα,5,7aα-tetrahydro-7-(hydroxymethyl)cyclopenta[c]pyran-4-carboxylic acid;GENIPOSIDIC ACID(SH) |
| CAS: | 27741-01-1 |
| MF: | C16H22O10 |
| MW: | 374.34 |
| EINECS: | |
| Product Categories: | chemical reagent;pharmaceutical intermediate;phytochemical;Inhibitors;Iridoids;reference standards from Chinese medicinal herbs (TCM).;standardized herbal extract |
| Mol File: | 27741-01-1.mol |
Geniposidic acid Chemical Properties
| Melting point | 138-140 °C(Solv: methanol (67-56-1)) |
| Boiling point | 684.1±55.0 °C(Predicted) |
| density | 1?+-.0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMF:30.0(Max Conc. mg/mL);80.14(Max Conc. mM) DMSO:48.67(Max Conc. mg/mL);130.01(Max Conc. mM) |
| form | powder |
| pka | 4.49±0.60(Predicted) |
| color | White |
| InChIKey | ZJDOESGVOWAULF-OVSXCSOGNA-N |
| SMILES | [C@@]12([H])C(CO)=CC[C@]1([H])C(C(=O)O)=CO[C@H]2O[C@H]1[C@H](O)[C@H]([C@H](O)[C@@H](CO)O1)O |&1:0,7,15,17,18,20,21,23,r| |
Safety Information
| WGK Germany | WGK 3 |
| HS Code | 29389090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
| Chemical Properties | White crystalline powder, easily soluble in water, ethanol, methanol, insoluble in n-butanol, ethyl acetate, insoluble in trichloromethane, benzene and petroleum ether, from gardenia, dragon boat flower, eucommia, waterline grass. |
| Uses | Geniposidic acid is an effective anticancer and radioprotection agent. Geniposidic acid might be a more potent tumor growth inhibitor than geniposide (GP) when combined with the X-irradiation, though there was no significant synergetic effect on their com |
| Definition | ChEBI: Geniposidic acid is a terpene glycoside. |
| target | HO-1 | IL Receptor | Caspase | FXR | MRP2 | BSEP |
| IC 50 | Human Endogenous Metabolite |
Geniposidic acid Preparation Products And Raw materials
| Raw materials | Geniposide |
