Giemsa stain CAS 51811-82-6
Introduction：Basic information about Giemsa stain CAS 51811-82-6, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Giemsa stain Basic information
| Product Name: | Giemsa stain |
| Synonyms: | Giemsa's stain: (& blood stain);Azure eosin methylene blue, Giemsa solution;Giemsa stain, modified;AZURE MIXTURE SICC GIEMSA STAIN;AZUR EOSIN METHYLENE-BLUE;AZURE EOSIN METHYLENE BLUE;EOSIN AZURE GIEMSA;EOSIN METHYLENE BLUE COMPOUND |
| CAS: | 51811-82-6 |
| MF: | C14Cl1H14N3S1 |
| MW: | 291.8 |
| EINECS: | 257-438-2 |
| Product Categories: | UVCBs-organic |
| Mol File: | 51811-82-6.mol |
Giemsa stain Chemical Properties
| Melting point | 300 °C(lit.) |
| Boiling point | >65°C/1013hPa |
| bulk density | 520kg/m3 |
| density | 0.99 |
| Fp | 15 °C |
| storage temp. | room temp |
| solubility | ethanol: 1 mg/mL |
| form | powder |
| color | Greenish-gold |
| PH | pH (25℃) : 6.0～8.0 |
| explosive limit | 5.5-44% (v/v) Methanol) |
| Water Solubility | Insoluble in water (<0.1%), methanol (5.8 mg/L), and ethanol. |
| λmax | 645-655 nm |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C14H13N3S.ClH/c1-17(2)10-4-6-12-14(8-10)18-13-7-9(15)3-5-11(13)16-12;/h3-8,15H,1-2H3;1H |
| InChIKey | NALREUIWICQLPS-UHFFFAOYSA-N |
| SMILES | [Cl-].CN(C)c1ccc2N=C3C=CC(=[NH2+])C=C3Sc2c1 |
| CAS DataBase Reference | 51811-82-6(CAS DataBase Reference) |
| EPA Substance Registry System | Giemsa's stain (51811-82-6) |
| Absorption | ≥0.6 at 647-653nm in methanol at 0.005g/L |
Safety Information
| Hazard Codes | Xi,T,F,Xn |
| Risk Statements | 41-39/23/24/25-23/24/25-11-63-62-46-36/38-21-52/53-22 |
| Safety Statements | 7-16-36/37-45-39-26-53-25-61 |
| RIDADR | UN 1230 3/PG 2 |
| WGK Germany | 3 |
| F | 12 |
| Autoignition Temperature | 455°C |
| TSCA | TSCA listed |
| HS Code | 32129000 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |
| Chemical Properties | DARK GREEN TO GREENISH-BLACK FINE CRYST. POWDER |
| Uses | Giemsa Stain is used as a laboratory reagent and stain for microscopy. It is also used for the histopathologic detection of malaria and other parasites such as spirochete and protozoan. The stain is also been incorporated in differential staining between bacterial and human cells. The compound has been used in combination with May-Grunwald or Wright Stain (sc-203763) as a histological hematology stain. |
| Uses | Giemsa stain has been used for the staining of cells and blood films. |
| Definition | ChEBI: Azure A is an organic chloride salt having 3-amino-7-(dimethylamino)phenothiazin-5-ium as the counterion. It is used in making azure eosin stains for blood smear staining. It has a role as a histological dye and a fluorochrome. It contains a 3-amino-7-(dimethylamino)phenothiazin-5-ium. |
| General Description | Modified Giemsa stain means when the pH of the Giemsa stain is changed from the usual 6.8 to 9.0. |
Giemsa stain Preparation Products And Raw materials
