Halosulfuron methyl CAS 100784-20-1
Introduction：Basic information about Halosulfuron methyl CAS 100784-20-1, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Halosulfuron methyl Basic information
| Product Name: | Halosulfuron methyl |
| Synonyms: | Halosulfuron-Methy;Halosulfuron-m;-1-methyl-1H-pyrazole-4-carboxylate;Methyl 3-chloro-5-(N-((4,6-dimethoxypyrimidin-2-yl);sulfamoyl);3-Chloro-5-[[3-(4,6-dimethoxypyrimidin-2-yl)ureido]sulfonyl]-1-methyl-1H-pyrazole-4-carboxylic Acid Methyl Ester;Methyl 3-Chloro-5-[[3-(4,6-dimethoxypyrimidin-2-yl)ureido]sulfonyl]-1-methyl-1H-pyrazole-4-carboxylate;SEMPRA(R) |
| CAS: | 100784-20-1 |
| MF: | C13H15ClN6O7S |
| MW: | 434.81 |
| EINECS: | 600-130-3 |
| Product Categories: | Herbicide;OLED |
| Mol File: | 100784-20-1.mol |
Halosulfuron methyl Chemical Properties
| Melting point | 175-177°C |
| density | 1.618 |
| storage temp. | 0-6°C |
| Water Solubility | Insoluble in water |
| solubility | Chloroform (Slightly), Methanol (Slightly, Heated) |
| pka | 11.96±0.70(Predicted) |
| color | White to Light yellow to Light orange |
| Merck | 14,4602 |
| Major Application | agriculture environmental |
| InChI | InChI=1S/C13H15ClN6O7S/c1-20-10(8(9(14)18-20)11(21)27-4)28(23,24)19-13(22)17-12-15-6(25-2)5-7(16-12)26-3/h5H,1-4H3,(H2,15,16,17,19,22) |
| InChIKey | FMGZEUWROYGLAY-UHFFFAOYSA-N |
| SMILES | N1(C)C(S(NC(NC2=NC(OC)=CC(OC)=N2)=O)(=O)=O)=C(C(OC)=O)C(Cl)=N1 |
| CAS DataBase Reference | 100784-20-1(CAS DataBase Reference) |
| EPA Substance Registry System | Halosulfuron-methyl (100784-20-1) |
Safety Information
| Hazard Codes | N |
| Risk Statements | 50/53 |
| Safety Statements | 60-61 |
| RIDADR | UN3077 9/PG 3 |
| WGK Germany | 3 |
| RTECS | UQ6392606 |
| HS Code | 2935.90.9500 |
| HazardClass | 9 |
| PackingGroup | III |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Repr. 1B |
| Toxicity | LD50 orally in rats: 8865 mg/kg; dermally in rabbits: >2000 mg/kg; LC50 (4 hr) in rats: >4.3 mg/l (Suzuki) |
| Uses | Herbicide. |
| Definition | ChEBI: Halosulfuron-methyl is a member of pyrazoles. |
| Hazard | Moderately toxic by ingestion. |
Halosulfuron methyl Preparation Products And Raw materials
