Introduction：Basic information about HEXADECANAMIDE CAS 629-54-9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
HEXADECANAMIDE Basic information
| Product Name: | HEXADECANAMIDE |
| Synonyms: | HEXADECANAMIDE;PALMITAMIDE;Amide 16;Amide HPL;Cetyl amide;n-Hexadecanamide;Palmitic acid amide;Palmitic amide |
| CAS: | 629-54-9 |
| MF: | C16H33NO |
| MW: | 255.44 |
| EINECS: | 211-095-5 |
| Product Categories: | Color Former & Related Compounds;Functional Materials;Sensitizer |
| Mol File: | 629-54-9.mol |
|
HEXADECANAMIDE Chemical Properties
| Melting point | 106°C |
| Boiling point | 236 °C / 12mmHg |
| density | 1.0000 |
| refractive index | 1.4545 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 16.61±0.40(Predicted) |
| form | Solid |
| color | White to Off-White |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| InChI | InChI=1S/C16H33NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h2-15H2,1H3,(H2,17,18) |
| InChIKey | HSEMFIZWXHQJAE-UHFFFAOYSA-N |
| SMILES | C(N)(=O)CCCCCCCCCCCCCCC |
| LogP | 6.200 (est) |
| EPA Substance Registry System | Hexadecanamide (629-54-9) |
Safety Information
| TSCA | TSCA listed |
| HS Code | 2924297099 |
HEXADECANAMIDE Usage And Synthesis
| Uses | Hexadecanamide can be used to prepare tissue regeneration. |
| Definition | ChEBI: A fatty amide that is the carboxamide derived from palmitic acid. |
| Safety Profile | When heated to decomposition it emits acrid smoke and irritating fumes |
| IC 50 | PPARα |
| Purification Methods | Crystallise the amide from thiophene-free *benzene and dry it under vacuum over P2O5. It is slightly soluble in EtOH, Me2CO, CHCl3 and toluene but insoluble in H2O. [Beilstein 2 H 374, 2 II 341, 2 III 975, 2 IV 1182.] |
HEXADECANAMIDE Preparation Products And Raw materials
| Raw materials | D-ERYTHRO-SPHINGOSINE-->1-Hexadecylamine-->Methanol-->Diethanolamine-->Palmitic acid |
| Preparation Products | HexadecanaMide, N-Methyl--->N,N-dimethylhexadecan-1-amide-->Oleamide |
