Hexarelin CAS 140703-51-1
Introduction：Basic information about Hexarelin CAS 140703-51-1, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Hexarelin Basic informationDescription Background
| Product Name: | Hexarelin |
| Synonyms: | HIS-D-2-METHYL-TRP-D-PHE-LYS-NH2;HIS-D-2-ME-TRP-ALA-TRP-D-PHE-LYS-NH2;HEXARELIN;GROWTH HORMONE RELEASING HEXAPEPTIDE;Examorelin;Hexareline;6-amino-2-[[2-[[2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)-1-oxopropyl]amino]-3-(2-methyl-1H-indol-3-yl)-1-oxopropyl]amino]-1-oxopropyl]amino]-3-(1H-indol-3-yl)-1-oxopropyl]amino]-1-oxo-3-phenylpropyl]a;Hexarelin/hexen |
| CAS: | 140703-51-1 |
| MF: | C47H58N12O6 |
| MW: | 887.04 |
| EINECS: | 1312995-182-4 |
| Product Categories: | Peptides;Glucagon receptor and related;Peptide;hormones;Anti-cancer&immunity |
| Mol File: | 140703-51-1.mol |
Hexarelin Chemical Properties
| Boiling point | 1403.6±65.0 °C(Predicted) |
| density | 1.322±0.06 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | H2O: soluble1mg/mL, clear, colorless |
| pka | 13.42±0.46(Predicted) |
| form | A crystalline solid |
| InChIKey | RVWNMGKSNGWLOL-GIIHNPQRSA-N |
| SMILES | C(N)(=O)[C@H](CCCCN)NC(=O)[C@@H](CC1=CC=CC=C1)NC(=O)[C@H](CC1C2=C(C=CC=C2)NC=1)NC(=O)[C@H](C)NC(=O)[C@@H](CC1C2=C(C=CC=C2)NC=1C)NC(=O)[C@H](CC1N=CNC=1)N |
| CAS DataBase Reference | 140703-51-1(CAS DataBase Reference) |
Safety Information
| WGK Germany | 3 |
| RTECS | OL4683333 |
| HS Code | 3504009000 |
| Description | Hexarelin, often referred to as Examorelin and Hexarelin Acetate is a potent, synthetic hexapeptide, which is known for enhancing growth hormone release. Hersarelin has similar benefits and functions to GHRP-6. However, studies have shown that it is much more potent than GHRP-6 and can further increase growth hormone levels. During clinical trials, it revealed its ability to increase body strength, reduce body fat boost muscle growth. And in veterinary research, hexarelin is used for cardiovascular health. |
| Chemical Properties | Pale Yellow Solid |
| Uses | Hexarelin is a synthetic growth hormone-releasing peptide (GHRP). |
| benefits | Its benefits include: Increase in lean muscle growth Improved sleep quality Enhance of athletic performance Increased flexibility and joint health Accelerated fat lossIncreased tendon and ligament strength Enhanced recovery time |
| Side effects | The side effects of Hexarelin include joint pain, water retention, increased cortisol levels, and desensitization of receptors. |
| Mode of action | Growth hormone is made and released by the pituitary gland. Hexarelin enhances natural growth hormone production by amplifying the natural growth hormone-releasing signal, resulting in a greater secretion of growth hormone from the pituitary gland. Hexarelin then suppresses a hormone in the body called somatostatin, also known as the growth hormone-inhibiting hormone. Somatostatin causes the body to reduce its natural growth hormone output. By limiting the action of somatostatin, growth hormone production is escalated, resulting in significantly increased natural growth hormone levels. Hexarelin can bind to and activate the growth hormone secretagogue receptor in the brain, similar to its natural counterpart ghrelin. However, hexarelin has been studied to be much more potent and stable than gherlin. The outlying distribution of growth hormone secretagogue in the heart and blood vessels suggests that Hexarelin may have direct cardiovascular actions beyond growth hormone release and neuroendocrine effects. |
| Description | Hexarelin has 7 amino acids H-His-D-2-Methyl-Trp-Ala-Trp-D-Phe-Lys-NH2 and having a molecular weight of 887 Dalton. The Molecular Formula is C47H58N12O6. |
| Background | Hexarelin stimulates GH secretion. Hexarelin is more resistant to proteolytic degradation than GHRP-6. |
Hexarelin Preparation Products And Raw materials
