ICG-Alkyne CAS 1622335-41-4
Introduction:Basic information about ICG-Alkyne CAS 1622335-41-4, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
ICG-Alkyne Basic information
| Product Name: | ICG-Alkyne |
| Synonyms: | ICG-Alkyne;ICG alkyne,ICG-alkyne;4-(2-(7-(1,1-dimethyl-3-(6-oxo-6-(prop-2-yn-1-ylamino)hexyl)-1,3-dihydro-2H-benzo[e]indol-2-ylidene)hepta-1,3,5-trien-1-yl)-1,1-dimethyl-1H-benzo[e]indol-3-ium-3-yl)butane-1-sulfonate |
| CAS: | 1622335-41-4 |
| MF: | C48H53N3O4S |
| MW: | 768.03 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 1622335-41-4.mol |
ICG-Alkyne Chemical Properties
| form | Solid |
| color | Brown to black |
| Appearance | Dark green solid |
| ε(extinction coefficient) | 232000 L⋅mol−1⋅cm−1 |
| Φ(quantum yield) | 0.09 |
| ex/em | 786/820nm (Methanol) |
| InChIKey | XXTDAEMDSXMISJ-UHFFFAOYSA-N |
| SMILES | CC1(C(=[N+](CCCCS([O-])(=O)=O)C2C=CC3=CC=CC=C3C1=2)C=CC=CC=CC=C1C(C2C3=CC=CC=C3C=CC=2N1CCCCCC(=O)NCC#C)(C)C)C |
Safety Information
| Chemical Properties | Appearance: Dark green solid ex/em: 786/820nm (methanol) Extinction coefficient (ε): 232000 L??mol??1??cm??1 Quantum yield (Φ): 0.09 |
| Uses | ICG-alkyne is a click chemistry reagent containing an azide group[1]. |
| References | [1] Takemiya K, et al. Maltohexaose-indocyanine green (MH-ICG) for near infrared imaging of endocarditis. PLoS One. 2021 Mar 1;16(3):e0247673. DOI:10.1371/journal.pone.0247673 |
