Introduction:Basic information about IODOBENZENE-D5 CAS 7379-67-1, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
IODOBENZENE-D5 Basic information
| Product Name: | IODOBENZENE-D5 |
| Synonyms: | IODOBENZENE-D5;IODOBENZENE-D5, 98+ ATOM % D;Acetaldehyde-D5;1,2,3,4,5-pentadeuterio-6-iodobenzene;IODOBENZENE (D5, 98%);6-iodobenzene-1,2,3,4,5-d5;Benzene-1,2,3,4,5-d5, 6-iodo-;Iodobenzene-d5 |
| CAS: | 7379-67-1 |
| MF: | C6H5I |
| MW: | 204.01 |
| EINECS: | |
| Product Categories: | Alphabetical Listings;I-L;Stable Isotopes |
| Mol File: | 7379-67-1.mol |
|
IODOBENZENE-D5 Chemical Properties
| Melting point | -29 °C (lit.) |
| Boiling point | 188 °C (lit.) |
| density | 1.868 g/mL at 25 °C |
| refractive index | n20/D 1.6161(lit.) |
| Fp | 74 °C |
| form | liquid |
| BRN | 2502031 |
| InChI | InChI=1S/C6H5I/c7-6-4-2-1-3-5-6/h1-5H/i1D,2D,3D,4D,5D |
| InChIKey | SNHMUERNLJLMHN-RALIUCGRSA-N |
| SMILES | IC1C([2H])=C([2H])C([2H])=C([2H])C=1[2H] |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22-36-41-20 |
| Safety Statements | 26-36-39 |
| RIDADR | UN 1993 / PGIII |
| WGK Germany | 3 |
| F | 3-8-10 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral |
IODOBENZENE-D5 Usage And Synthesis
| Uses | Iodobenzene-d5 is the deuterium labeled 1-Iodobenzene[1]. |
| Uses | Iodobenzene D5's primary uses is as a powerful labeled compound in organic and medicinal chemistry. Another significant application of it is as an NMR standard for deuterium NMR spectroscopy. |
| References | [1] Russak EM, et al. Impact of Deuterium Substitution on the Pharmacokinetics of Pharmaceuticals. Ann Pharmacother. 2019 Feb;53(2):211-216. DOI:10.1177/1060028018797110 |
IODOBENZENE-D5 Preparation Products And Raw materials