Introduction：Basic information about Isodecyl diphenyl phosphite CAS 26544-23-0, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Isodecyl diphenyl phosphite Basic information
| Product Name: | Isodecyl diphenyl phosphite |
| Synonyms: | chelexmd;IRGAFOS DDPP;DIPHENYL ISODECYL PHOSPHITE;Di-Phenyl isodecyl Phosphite (DPDP;Isodecyldiphenylphosphit;8-Methylnonyl diphenyl phosphite;JACS-26544-23-0;dpdp |
| CAS: | 26544-23-0 |
| MF: | C22H31O3P |
| MW: | 374.45 |
| EINECS: | 247-777-4 |
| Product Categories: | |
| Mol File: | 26544-23-0.mol |
|
Isodecyl diphenyl phosphite Chemical Properties
| Melting point | 18 °C |
| Boiling point | 170℃ |
| density | 1.03g/mL (25℃) |
| refractive index | 1.516～1.519 |
| Fp | 154℃ |
| solubility | Soluble in most organic solvents, insoluble in water. |
| form | transparent liquid |
| color | Colourless or light yellow |
| Viscosity | 10.3mPa.s (38℃) |
| InChI | InChI=1S/C22H31O3P/c1-20(2)14-8-4-3-5-13-19-23-26(24-21-15-9-6-10-16-21)25-22-17-11-7-12-18-22/h6-7,9-12,15-18,20H,3-5,8,13-14,19H2,1-2H3 |
| InChIKey | ADRNSOYXKABLGT-UHFFFAOYSA-N |
| SMILES | P(OCCCCCCCC(C)C)(OC1=CC=CC=C1)OC1=CC=CC=C1 |
| EPA Substance Registry System | Isodecyl diphenyl phosphite (26544-23-0) |
Safety Information
Isodecyl diphenyl phosphite Usage And Synthesis
| Uses | Diphenyl isodecyl phosphite (DPDP) is a phosphite-based antioxidant. DPDP is mainly used as a color-retention and processing stabilizer in polycarbonate, polyurethane, ABS resin, coatings, etc., such as in polyether-type flexible foam and RIM polyurethane. |
| Hazard | A mild eye irritant. |
Isodecyl diphenyl phosphite Preparation Products And Raw materials
