ISOTETRANDRINE CAS 477-57-6
Introduction:Basic information about ISOTETRANDRINE CAS 477-57-6, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
ISOTETRANDRINE Basic information
| Product Name: | ISOTETRANDRINE |
| Synonyms: | 1-isotetrandrine;6,6’,7,12-tetramethoxy-2,2’-dimethyl-berbama;isosinomenina;isosinomeninea;o,o’-dimethylobamegine;o,o’-dimethylstepholine;O-METHYLBERBAMINE;BERBAMINE METHYL ETHER |
| CAS: | 477-57-6 |
| MF: | C38H42N2O6 |
| MW: | 622.76 |
| EINECS: | |
| Product Categories: | Alkaloids |
| Mol File: | 477-57-6.mol |
ISOTETRANDRINE Chemical Properties
| Melting point | 180-182℃ |
| Boiling point | 710.5±60.0 °C(Predicted) |
| density | 1.172 |
| RTECS | NX7285000 |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Off-white solid. |
| pka | 7.70±0.20(Predicted) |
| color | White to light yellow |
| InChIKey | WVTKBKWTSCPRNU-PKGWHCLJNA-N |
| SMILES | O(C1C(=CC2CCN(C)[C@]3([H])CC4=CC=C(OC)C(OC5C=CC(=CC=5)C[C@]5([H])N(C)CCC6C=C(OC)C(=CC=65)OC=1C3=2)=C4)OC)C |&1:9,27,r| |
Safety Information
| Description | A bisbenzylisoquinoline alkaloid, shown to be identical with berbamine methyl ether, this base occurs in A therosperrna rnoschaturn, Berberis japonica and Stephania cephalantha. It is dextrorotatory with [α]17D + 146° or[α]20D + 150.7° (c 0.85, CHC13). When recrystallized from MeOH it forms colourless crystals and furnishes a crystalline dimethiodide, m.p. 242°C. Four methoxyl groups and two methylimino groups are present. |
| Uses | Isotetrandrine is a biscoclaurine alkaloid inhibitor of G protein activation of PLA2. |
| target | IL Receptor | NF-kB | MAPK | Nrf2 | HO-1 | JNK |
| References | Kondo et al., J. Pharrn. Soc., Japan, 58,920 (1938) Tomita, Fujita, Morai., ibid, 71,226,301 (1951) Bick, Clezy, Crow., Austral. J. Chern., 9, III (1956) Synthesis: Inubushi et ai., Tetrahedron Lett., 3399 (1968) |
