Introduction：Basic information about Lenacil CAS 2164-08-1, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Lenacil Basic information
| Product Name: | Lenacil |
| Synonyms: | 1H-Cyclopentapyrimidine-2,4(3H,5H)-dione, 3-cyclohexyl-6,7-dihydro-;1H-Cyclopentapyrimidine-2,4(3H,5H)-dione, 6,7-dihydro-3-cyclohexyl-;3-Cyclohexyl-1,5,6,7-tetrahydo-2H-cyclopentapyrimidine-2,4(3H)-dione;3-Cyclohexyl-1,5,6,7-tetrahydrocyclopentapyrimidine-2,4(3H)-dione;3-Cyclohexyl-2-hydroxy-3,5,6,7-tetrahydro-4H-cyclopenta[d]pyrimidin-4-one;3-Cyclohexyl-5,6-trimethylenuracil;5h)-dione,6,7-dihydro-3-cyclohexyl-1h-cyclopentapyrimidine-4(3h;experimentalherbicide634 |
| CAS: | 2164-08-1 |
| MF: | C13H18N2O2 |
| MW: | 234.29 |
| EINECS: | 218-499-0 |
| Product Categories: | |
| Mol File: | 2164-08-1.mol |
|
Lenacil Chemical Properties
| Melting point | 316-326°C |
| Boiling point | 376.62°C (rough estimate) |
| density | d20 1.32 kg/l |
| refractive index | 1.6450 (estimate) |
| storage temp. | 0-6°C |
| form | Solid |
| pka | 10.66±0.20(Predicted) |
| color | White to off-white |
| Water Solubility | 6mg/L(25 ºC) |
| Merck | 13,5455 |
| Major Application | agriculture
environmental |
| InChI | 1S/C13H18N2O2/c16-12-10-7-4-8-11(10)14-13(17)15(12)9-5-2-1-3-6-9/h9H,1-8H2,(H,14,17) |
| InChIKey | ZTMKADLOSYKWCA-UHFFFAOYSA-N |
| SMILES | O=C1NC2=C(CCC2)C(=O)N1C3CCCCC3 |
| LogP | 2.860 (est) |
| CAS DataBase Reference | 2164-08-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Lenacil(2164-08-1) |
| EPA Substance Registry System | Lenacil (2164-08-1) |
Safety Information
| Hazard Codes | N |
| Risk Statements | 50/53 |
| Safety Statements | 60-61 |
| RIDADR | UN 3077 |
| WGK Germany | WGK 2 |
| RTECS | GY5875000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1
Carc. 2 |
| Toxicity | LD50 (80% wettable powder) orally in rats: >11,000 mg/kg; LC50 96 hr in bluegill sunfish; rainbow trout: 100-1000; 135 mg/l; LC50 8 day in bobwhite quail, Peking duck (mg/kg): 2300, >5620. (DuPont technical data sheet) |
Lenacil Usage And Synthesis
| Uses | Lenacil acts similarly in weed control. It is used preplantingby soil incorporation or as a preemergence treatment offodder, red beets, and sugar beets. The chemical is also usedon spinach, strawberries, and various ornamentals. Usagerates range from 0.4 to 1.2 kg/ha depending on the crop andsoil type. |
| Uses | Lenacil is an herbicide used in the protection of crops. Non-cytotoxic agent. |
| Uses | Herbicide. |
| Definition | ChEBI: A cyclopentapyrimidine that is 6,7-dihydro-1H-cyclopenta[d]pyrimidine-2,4(3H,5H)-dione substituted by a cyclohexyl group at position 3. |
| Agricultural Uses | Herbicide: Systemic herbicide that attacks roots. |
| Trade name | LENAZAR FLO®; SAFARI LITE®;VENZAR Flowable® |
Lenacil Preparation Products And Raw materials
| Raw materials | 1-Cyclohexyl-3-(2-butoxycarbonylcyclopent-1-enyl)urea |
