Introduction：Basic information about MABUTEROL CAS 56341-08-3, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
MABUTEROL Basic information
| Product Name: | MABUTEROL |
| Synonyms: | MABUTEROL;Ambuterol;Benzenemethanol, 4-amino-3-chloro-a-[[(1,1-dimethylethyl)amino]methyl]-5-(trifluoromethyl)- (9CI);PB 868Cl;4-Amino-3-chloro-α-[[(1,1-dimethylethyl)amino]methyl]-5-(trifluoromethyl)benzenemethanol;1-[4-azanyl-3-chloro-5-(trifluoromethyl)phenyl]-2-(tert-butylamino)ethanol;4-Amino-3-chloro-alpha-[[(tert-butyl)amino]methyl]-5-(trifluoromethyl)benzenemethanol hydrochloride;MABUTEROL HCl 99% |
| CAS: | 56341-08-3 |
| MF: | C13H18ClF3N2O |
| MW: | 310.74 |
| EINECS: | 1312995-182-4 |
| Product Categories: | Amines;Intermediates & Fine Chemicals;Pharmaceuticals |
| Mol File: | 56341-08-3.mol |
|
MABUTEROL Chemical Properties
| Melting point | 85-87?C |
| Boiling point | 375.9±37.0 °C(Predicted) |
| density | 1.278±0.06 g/cm3(Predicted) |
| storage temp. | Hygroscopic, -20°C Freezer, Under Inert Atmosphere |
| solubility | DMF: 30 mg/ml; DMSO: 30 mg/ml; Ethanol: 30 mg/ml |
| form | A crystalline solid |
| pka | 13.37±0.20(Predicted) |
| color | White to off-white |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C13H18ClF3N2O/c1-12(2,3)19-6-10(20)7-4-8(13(15,16)17)11(18)9(14)5-7/h4-5,10,19-20H,6,18H2,1-3H3 |
| InChIKey | JSJCTEKTBOKRST-UHFFFAOYSA-N |
| SMILES | C1(C(F)(F)F)=C(N)C(=CC(C(O)CNC(C)(C)C)=C1)Cl |
Safety Information
MABUTEROL Usage And Synthesis
| Description | Mabuterol is an orally activeβ2-adrenergic agonist related to Clenbuterol. |
| Chemical Properties | Yellow Solid |
| Uses | As a β2-adrenergic agonist, Mabuterol can be used as a bronchodilator/antiasthmatic |
| Definition | ChEBI: Mabuterol is a member of (trifluoromethyl)benzenes. |
| IC 50 | Beta-2 adrenergic receptor |
MABUTEROL Preparation Products And Raw materials
| Raw materials | Ethanone, 1-[4-amino-3-chloro-5-(trifluoromethyl)phenyl]-2-[(1,1-dimethylethyl)amino]--->4'-Amino-3'-chloro-5'-(trifluoromethyl)acetophenon-->1-(4-amino-3-chloro-5-(trifluoromethyl)phenyl)-2-bromoethanone |
