Mal-PEG8-NHS ester CAS 2055033-05-9
Introduction:Basic information about Mal-PEG8-NHS ester CAS 2055033-05-9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Mal-PEG8-NHS ester Basic information
| Product Name: | Mal-PEG8-NHS ester |
| Synonyms: | 2,5-Dioxo-1-pyrrolidinyl 1-(2,5-Dioxo-2,5-dihydro-1-pyrrolyl)-3,6,9,12,15,18,21,24-octaoxa-27-heptacosanoate;Mal-PEG8-NHS ester;4,7,10,13,16,19,22,25-Octaoxaheptacosanoic acid, 27-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)-, 2,5-dioxo-1-pyrrolidinyl ester;(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate;Mal-PEG8-CH2CH2COONHS;2,5-Dioxopyrrolidin-1-yl 1-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)-3,6,9,12,15,18,21,24-octaoxaheptacosan-27-oate |
| CAS: | 2055033-05-9 |
| MF: | C27H42N2O14 |
| MW: | 618.63 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 2055033-05-9.mol |
Mal-PEG8-NHS ester Chemical Properties
| Boiling point | 689.3±65.0 °C(Predicted) |
| density | 1.29±0.1 g/cm3(Predicted) |
| solubility | Soluble in DMSO, DCM, DMF |
| pka | -2.34±0.20(Predicted) |
| form | Viscous Liquid |
| color | Colorless to light yellow |
| InChI | InChI=1S/C27H42N2O14/c30-23-1-2-24(31)28(23)6-8-36-10-12-38-14-16-40-18-20-42-22-21-41-19-17-39-15-13-37-11-9-35-7-5-27(34)43-29-25(32)3-4-26(29)33/h1-2H,3-22H2 |
| InChIKey | JJKBMZPIICCZSX-UHFFFAOYSA-N |
| SMILES | C(ON1C(=O)CCC1=O)(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCN1C(=O)C=CC1=O |
Safety Information
| Description | Mal-PEG8-NHS ester is a PEG linker containing a maleimide group and an NHS ester group. The hydrophilic PEG spacer increases solubility in aqueous media. |
| Uses | Mal-PEG8-NHS ester can be used to label the primary amines (-NH2) of proteins, amine-modified oligonucleotides, and other amine-containing molecules. |
| IC 50 | PEGs |
