Introduction:Basic information about MATAIRESINOL CAS 580-72-3, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
MATAIRESINOL Basic information
| Product Name: | MATAIRESINOL |
| Synonyms: | (αR,βR)-α,β-Bis(4-hydroxy-3-methoxybenzyl)butyrolactone;(3R)-3α,4β-Bis(3-methoxy-4-hydroxybenzyl)-4,5-dihydrofuran-2(3H)-one;(3R)-3α,4β-Bis(4-hydroxy-3-methoxybenzyl)tetrahydrofuran-5-one;(3R,4R)-3,4-Bis(3-methoxy-4-hydroxybenzyl)tetrahydrofuran-2-one;(3R,4R)-4,5-Dihydro-3,4-bis[(4-hydroxy-3-methoxyphenyl)methyl]furan-2(3H)-one;(3R,4R)-3,4-bis(4-hydroxy-3-methoxy-benzyl)tetrahydrofuran-2-one;(3R,4R)-3,4-bis[(4-hydroxy-3-methoxy-phenyl)methyl]oxolan-2-one;(3R,4R)-3,4-bis[(4-hydroxy-3-methoxyphenyl)methyl]oxolan-2-one |
| CAS: | 580-72-3 |
| MF: | C20H22O6 |
| MW: | 358.39 |
| EINECS: | 200-258-5 |
| Product Categories: | Miscellaneous Natural Products |
| Mol File: | 580-72-3.mol |
|
MATAIRESINOL Chemical Properties
| Melting point | 119~120℃ |
| Boiling point | 593.0±45.0 °C(Predicted) |
| density | 1.290±0.06 g/cm3(Predicted) |
| FEMA | 4762 | (-)-MATAIRESINOL |
| storage temp. | 2-8°C |
| solubility | Acetone (Slightly), Chloroform (Slightly), Methanol (Slightly) |
| form | White to off-white solid. |
| pka | 10.02±0.20(Predicted) |
| color | White to Off-White |
| JECFA Number | 2210 |
| BRN | 7826317 |
| Stability: | Hygroscopic |
| Cosmetics Ingredients Functions | SKIN CONDITIONING - EMOLLIENT |
| InChI | InChI=1S/C20H22O6/c1-24-18-9-12(3-5-16(18)21)7-14-11-26-20(23)15(14)8-13-4-6-17(22)19(10-13)25-2/h3-6,9-10,14-15,21-22H,7-8,11H2,1-2H3/t14-,15+/m0/s1 |
| InChIKey | MATGKVZWFZHCLI-LSDHHAIUSA-N |
| SMILES | O1C[C@H](CC2=CC=C(O)C(OC)=C2)[C@@H](CC2=CC=C(O)C(OC)=C2)C1=O |
| LogP | 1.655 (est) |
Safety Information
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| F | 10-21 |
| HazardClass | IRRITANT |
| Storage Class | 11 - Combustible Solids |
MATAIRESINOL Usage And Synthesis
| Uses | Matairesinol is a principle plant lignan consituent of dietary fiber. |
| Definition | ChEBI: (-)-matairesinol is a lignan that is gamma-butyrolactone in which the 3 and 4 positions are substituted by 4-hydroxy-3-methoxybenzyl groups (the 3R,4R-diastereomer). It has a role as a phytoestrogen, a plant metabolite, an angiogenesis inhibitor and an anti-asthmatic agent. It is a polyphenol, a lignan and a gamma-lactone. |
MATAIRESINOL Preparation Products And Raw materials