Melamine cyanurate CAS 37640-57-6
Introduction：Basic information about Melamine cyanurate CAS 37640-57-6, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Melamine cyanurate Basic information
| Product Name: | Melamine cyanurate |
| Synonyms: | MELAMINE CYANURATE;1,3,5-triazine-2,4,6(1h,3h,5h)-trione,compd.with1,3,5-triazine-2,4,6-triam;1,3,5-triazine-2,4,6(1h,3h,5h)-trione,compd.with1,3,5-triazine-2,4,6-triamin;1,3,5-Triazine-2,4,6(1H,3H,5H)-trione,compd.with1,3,5-triazine-2,4,6-triamine(1:1);FR-MC;Melamine cyanurate (1:1);Melamine Cyanurate (MC);2,4,6-triamino-s-triazincompd.withs-triazine-triol |
| CAS: | 37640-57-6 |
| MF: | C6H9N9O3 |
| MW: | 255.2 |
| EINECS: | 253-575-7 |
| Product Categories: | Flame retardant;MCA |
| Mol File: | 37640-57-6.mol |
Melamine cyanurate Chemical Properties
| Melting point | 350°C (dec.) |
| density | 1.70 |
| refractive index | 1.571 |
| storage temp. | Refrigerator |
| solubility | Acidic DMSO (Sparingly), Aqueous Acid (Slightly) |
| form | Solid |
| color | White to Off-White |
| Odor | Slight odor |
| Water Solubility | insoluble |
| InChI | InChI=1S/C3H6N6.C3H3N3O3/c4-1-7-2(5)9-3(6)8-1;7-1-4-2(8)6-3(9)5-1/h(H6,4,5,6,7,8,9);(H3,4,5,6,7,8,9) |
| InChIKey | ZQKXQUJXLSSJCH-UHFFFAOYSA-N |
| SMILES | NC1=NC(N)=NC(N)=N1.O=C1NC(=O)NC(=O)N1 |
| LogP | -2.28 at 25℃ |
| CAS DataBase Reference | 37640-57-6(CAS DataBase Reference) |
| EPA Substance Registry System | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, compd. with 1,3,5-triazine-2,4,6-triamine (1:1) (37640-57-6) |
Safety Information
| TSCA | TSCA listed |
| Chemical Properties | Melamine cyanurate is non-flammable and has very stable chemical properties. |
| Uses | Environmental-friendly halogen-free inflaming lubricating agent |
| Uses | Melamine Cyanurate is a crystalline complex formed between Melamine (M208700) and Cyanuric Acid (C987715), and is unique in that it is a halogen-free flame retardant. |
| Application | Melamine cyanurate is particularly effective in improving fire safety of nitrogen-based polymers, such as polyamides (nylons) and thermoplastics (polyurethane). It can be used in epoxy polymers and in a variety of other substrates. |
| Definition | ChEBI: A crystalline complex formed from a 1:1 mixture of melamine and cyanuric (isocyanuric) acid, held together by an extensive two-dimensional network of hydrogen bonds between the two compounds. |
| Flammability and Explosibility | Not classified |
| Synthesis | Melamine cyanurate is synthesised by reacting cyanuric acid and melamine in an aqueous medium in the presence of strong mineral acids. This reaction requires the presence of a strong inorganic acid (hydrochloric acid) at a pH not exceeding 1. |
Melamine cyanurate Preparation Products And Raw materials
| Preparation Products | AMMELIDE |
