Introduction：Basic information about Methyl 2-benzoylbenzoate CAS 606-28-0, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Methyl 2-benzoylbenzoate Basic information
| Product Name: | Methyl 2-benzoylbenzoate |
| Synonyms: | O-BENZOYLBENZOIC ACID METHYL ESTER;O-BENZOYL BENZOMETHOXYCARBONYL;OBM;IHT-PI OMBB;methyl 2-phenylcarbonylbenzoate;o-Methyl-benzoyl Benzoate;OMNIRADOMBB;2-(Methoxycarbonyl)benzophenone |
| CAS: | 606-28-0 |
| MF: | C15H12O3 |
| MW: | 240.25 |
| EINECS: | 210-112-3 |
| Product Categories: | Aromatic Esters;FINE Chemical & INTERMEDIATES;Industrial/Fine Chemicals;Building Blocks;C12 to C63;Carbonyl Compounds;Chemical Synthesis;Organic Building Blocks;Functional Materials;Photopolymerization Initiators;C12 to C63;Carbonyl Compounds;Esters;API intermediates;606-28-0 |
| Mol File: | 606-28-0.mol |
|
Methyl 2-benzoylbenzoate Chemical Properties
| Melting point | 48-53 °C (lit.) |
| Boiling point | 352 °C |
| density | 1,69 g/cm3 |
| vapor pressure | 0Pa at 20℃ |
| refractive index | 1.5740 (estimate) |
| Fp | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Insoluble in water |
| form | powder to crystal |
| color | White to Orange to Green |
| Water Solubility | 117.7mg/L at 20℃ |
| InChI | 1S/C15H12O3/c1-18-15(17)13-10-6-5-9-12(13)14(16)11-7-3-2-4-8-11/h2-10H,1H3 |
| InChIKey | NQSMEZJWJJVYOI-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccccc1C(=O)c2ccccc2 |
| LogP | 2.8 at 25℃ |
| CAS DataBase Reference | 606-28-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzoic acid, 2-benzoyl-, methyl ester(606-28-0) |
| EPA Substance Registry System | Methyl o-benzoylbenzoate (606-28-0) |
Safety Information
| Hazard Codes | N |
| Risk Statements | 50/53 |
| Safety Statements | 60-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 9 |
| HS Code | 29183000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1 |
Methyl 2-benzoylbenzoate Usage And Synthesis
| Chemical Properties | White or yellowish granule crystals, soluble in alcohol and alkali solution, almost insoluble in water when precipitated in acid. |
| Uses | Methyl 2-benzoylbenzoate is used as an anti-ultraviolet absorber and a preservative for food and beverages. |
| Preparation | Methyl-2-benzoylbenzoate can be synthesized from the reaction between corresponding 2-substituted benzoic acid and thionyl chloride in methanol. |
| Definition | ChEBI: Methyl 2-benzoylbenzoate is a member of benzophenones. |
| General Description | Methyl-2-benzoylbenzoate is a 2-acylarylcarboxylate. It can undergo asymmetric transfer hydrogenation reaction in propanol in the presence of a Ruthenium catalyst. Methyl-2-benzoylbenzoate is formed as one of the reaction products during the reaction between methyl benzoate and lithium 2,2,6,6-tetramethylpiperidide (LiTMP) at -117°C. |
| Flammability and Explosibility | Non flammable |
Methyl 2-benzoylbenzoate Preparation Products And Raw materials
| Raw materials | Thionyl chloride-->Methanol-->2-Biphenylcarboxylic acid |
