Introduction：Basic information about methyl 3-amino-2-fluorobenzoate CAS 1195768-18-3, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
methyl 3-amino-2-fluorobenzoate Basic information
| Product Name: | methyl 3-amino-2-fluorobenzoate |
| Synonyms: | methyl 3-amino-2-fluorobenzoate;2-Fluoro-3-(methoxycarbonyl)aniline;3-amino-2-fluoroBenzoic acid Methyl ester;Methyl 2-fluoro-3-aminobenzoate;CL029;Benzoic acid, 3-amino-2-fluoro-, methyl ester;methyl 3-amino-2-fluorobenzoate ISO 9001：2015 REACH;3-?amino-?2-?fluoro-?, methyl ester Benzoic acid |
| CAS: | 1195768-18-3 |
| MF: | C8H8FNO2 |
| MW: | 169.15 |
| EINECS: | 629-868-4 |
| Product Categories: | |
| Mol File: | 1195768-18-3.mol |
|
methyl 3-amino-2-fluorobenzoate Chemical Properties
| Boiling point | 282.6±25.0 °C(Predicted) |
| density | 1.264±0.06 g/cm3(Predicted) |
| refractive index | 1.5570 to 1.5610 |
| storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C |
| form | clear liquid |
| pka | 2.06±0.10(Predicted) |
| color | Colorless to Light orange to Yellow |
| InChI | InChI=1S/C8H8FNO2/c1-12-8(11)5-3-2-4-6(10)7(5)9/h2-4H,10H2,1H3 |
| InChIKey | UOYDNSRSUSNCKS-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC=CC(N)=C1F |
| CAS DataBase Reference | 1195768-18-3 |
Safety Information
methyl 3-amino-2-fluorobenzoate Usage And Synthesis
| Chemical Properties | white solid. |
| Uses | Methyl 3-amino-2-fluorobenzoate is an important compound during the synthesis of Dabrafenib. Dabrafenib is a type of kinase inhibitor that is commonly prescribed to individuals suffering from certain forms of melanoma, non-small cell lung cancer, and thyroid cancer. |
methyl 3-amino-2-fluorobenzoate Preparation Products And Raw materials
| Raw materials | Methanol-->3-Amino-2-fluorobenzoic acid-->2-Fluoro-3-nitrobenzoic acid-->methyl 2-fluoro-3-nitrobenzoate |
| Preparation Products | Dabrafenib Mesylate-->Dabrafenib |
