Introduction：Basic information about Methyl 3-formyl-4-nitrobenzoate CAS 148625-35-8, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Methyl 3-formyl-4-nitrobenzoate Basic information
| Product Name: | Methyl 3-formyl-4-nitrobenzoate |
| Synonyms: | METHYL 3-FORMYL-4-NITROBENZOATE 97;AL1HYL 3-FORMYL-4-NITROBENZOATE, 97%;5-Methoxycarbonyl-2-nitrobenzaldehyde;Benzoic acid, 3-forMyl-4-nitro-, Methyl ester;Methyl 3-forMyl-4-nitrobenzoate 97%;METHYL 3-FORMYL-4-NITROBENZOATE;3-Formyl-4-nitrobenzoicacid me |
| CAS: | 148625-35-8 |
| MF: | C9H7NO5 |
| MW: | 209.16 |
| EINECS: | |
| Product Categories: | Aldehydes;C9;Carbonyl Compounds |
| Mol File: | 148625-35-8.mol |
|
Methyl 3-formyl-4-nitrobenzoate Chemical Properties
| Melting point | 72-76 °C (lit.) |
| Boiling point | 385.1±37.0 °C(Predicted) |
| density | 1.386 |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | solid |
| Appearance | White to yellow Solid |
| InChI | InChI=1S/C9H7NO5/c1-15-9(12)6-2-3-8(10(13)14)7(4-6)5-11/h2-5H,1H3 |
| InChIKey | JHFSCEMUDKRPID-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC=C([N+]([O-])=O)C(C=O)=C1 |
| CAS DataBase Reference | 148625-35-8 |
Safety Information
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
Methyl 3-formyl-4-nitrobenzoate Usage And Synthesis
| Uses | Methyl 3-Formyl-4-nitrobenzoate is a useful research chemical used in the preparation of ring-fused aminals via α-amination of cyclic amines. |
Methyl 3-formyl-4-nitrobenzoate Preparation Products And Raw materials
| Preparation Products | 4-Amino-3-formyl-benzoic acid methyl ester |
