Introduction：Basic information about Methyl 4-amino-5-ethylsulfonyl-2-methoxybenzoate CAS 80036-89-1, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Methyl 4-amino-5-ethylsulfonyl-2-methoxybenzoate Basic information
| Product Name: | Methyl 4-amino-5-ethylsulfonyl-2-methoxybenzoate |
| Synonyms: | Amisulpride Impurity 5;2-methoxy-4-amino-5-ethysulfonyl benzoic acid methyl ester;Methyl 4-amino-5-ethylsulfonyl-2-methoxybenzoate;METHYL 4-AMINO-5-(ETHYLSULPHONYL)-2-METHOXYBENZOATE;2-methoxyl-4-amine-5-ethylsulfonyl methyl benzoate;2-Methoxyl-4-Amino-5-Ethylsulfonyl Methyl Benzoate;2-Methoxy-4-amino-5-ethsulfonyl benzoic acid methyl ester;2-METHOXYL-4-AMINO-5-ETHYLSULFONYLBENZOIC METHYL ESTER |
| CAS: | 80036-89-1 |
| MF: | C11H15NO5S |
| MW: | 273.31 |
| EINECS: | 616-818-1 |
| Product Categories: | |
| Mol File: | 80036-89-1.mol |
|
Methyl 4-amino-5-ethylsulfonyl-2-methoxybenzoate Chemical Properties
| Boiling point | 514.5±50.0 °C(Predicted) |
| density | 1.289±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | solid |
| pka | -2.97±0.13(Predicted) |
| color | White |
| InChI | InChI=1S/C11H15NO5S/c1-4-18(14,15)10-5-7(11(13)17-3)9(16-2)6-8(10)12/h5-6H,4,12H2,1-3H3 |
| InChIKey | BBWJVKZAKHIKRQ-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC(S(CC)(=O)=O)=C(N)C=C1OC |
| CAS DataBase Reference | 80036-89-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Hazard Note | Irritant |
| HS Code | 2922500090 |
Methyl 4-amino-5-ethylsulfonyl-2-methoxybenzoate Usage And Synthesis
| Uses | Methyl 4-amino-5-(ethylsulphonyl)-2-methoxybenzoate is a useful research chemical. |
Methyl 4-amino-5-ethylsulfonyl-2-methoxybenzoate Preparation Products And Raw materials
