Introduction：Basic information about Methyl rosmarinate CAS 99353-00-1, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Methyl rosmarinate Basic information
| Product Name: | Methyl rosmarinate |
| Synonyms: | Methyl rosmarinate;rosmarinic acid methyl ester;Benzenepropanoic acid, α-[[(2E)-3-(3,4-dihydroxyphenyl)-1-oxo-2-propen-1-yl]oxy]-3,4-dihydroxy-, methyl ester, (αR)-;(R)-3-(3,4-Dihydroxyphenyl)-1-methoxy-1-oxopropan-2-yl (E)-3-(3,4-dihydroxyphenyl)acrylate;Methyl rosmarinate, 10 mM in DMSO;Methylrosmarinic acid;Rosmarinic ester |
| CAS: | 99353-00-1 |
| MF: | C19H18O8 |
| MW: | 374.35 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 99353-00-1.mol |
|
Methyl rosmarinate Chemical Properties
| Boiling point | 655.4±55.0 °C(Predicted) |
| density | 1.449±0.06 g/cm3(Predicted) |
| storage temp. | 4°C, protect from light |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| pka | 9.29±0.10(Predicted) |
| color | White to off-white |
| InChI | InChI=1/C19H18O8/c1-26-19(25)17(10-12-3-6-14(21)16(23)9-12)27-18(24)7-4-11-2-5-13(20)15(22)8-11/h2-9,17,20-23H,10H2,1H3/b7-4+/t17-/s3 |
| InChIKey | XHALVRQBZGZHFE-NSRMBFSVNA-N |
| SMILES | C(C1C=CC(O)=C(O)C=1)[C@H](C(=O)OC)OC(=O)/C=C/C1C=CC(O)=C(O)C=1 |&1:9,r| |
Safety Information
Methyl rosmarinate Usage And Synthesis
| Uses | Methyl Rosmarinate is a novel S6K1 inhibitor, used as a therapeutic agent against cervical cancer.Methyl Rosmarinate is a noncompetitive tyrosinase inhibitor which is isolated from Rabdosia serra. An inhibitor of a-glucosidase |
| Definition | ChEBI: Methyl rosmarinate is a hydroxycinnamic acid. |
Methyl rosmarinate Preparation Products And Raw materials
