Introduction：Basic information about Methyl-2-mercaptobenzimidazole CAS 53988-10-6, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Methyl-2-mercaptobenzimidazole Basic information
| Product Name: | Methyl-2-mercaptobenzimidazole |
| Synonyms: | 1,3-dihydro-4(or5)-methyl-2H-Benzimidazole-2-thione;2-mercapto-4(or5)-methylbenzimidazole;2-mercaptomethylbenzimidazole;4(or5)-Methyl-2-mercaptobenzimidazole;methylmercaptobenzimidazole;nocracmmb;Rubber Antioxidant Methyl-2-mercaptobenzimidazole;vulkanoxmb2 |
| CAS: | 53988-10-6 |
| MF: | C8H8N2S |
| MW: | 164.23 |
| EINECS: | 258-904-8 |
| Product Categories: | Lansoprazole;Imidazoles & Benzimidazoles;Imidazoles & Benzimidazoles |
| Mol File: | 53988-10-6.mol |
|
Methyl-2-mercaptobenzimidazole Chemical Properties
| Melting point | 300-304 °C(lit.) |
| density | 1.25 |
| vapor pressure | 0.002Pa at 25℃ |
| refractive index | 1.5700 (estimate) |
| Water Solubility | 120mg/L at 20℃ |
| InChI | InChI=1S/C8H8N2S/c1-5-3-2-4-6-7(5)10-8(11)9-6/h2-4H,1H3,(H2,9,10,11) |
| InChIKey | UDQCDDZBBZNIFA-UHFFFAOYSA-N |
| SMILES | C1(S)NC2=CC=CC(C)=C2N=1 |
| LogP | 0.4 at 25℃ |
| CAS DataBase Reference | 53988-10-6(CAS DataBase Reference) |
| EPA Substance Registry System | 2H-Benzimidazole-2-thione, 1,3-dihydro-4(or 5)-methyl- (53988-10-6) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 2 |
| RTECS | DE1050000 |
| TSCA | TSCA listed |
Methyl-2-mercaptobenzimidazole Usage And Synthesis
| Flammability and Explosibility | Non flammable |
Methyl-2-mercaptobenzimidazole Preparation Products And Raw materials
