Introduction：Basic information about Methyltris(methylethylketoxime)silane CAS 22984-54-9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Methyltris(methylethylketoxime)silane Basic informationApplication
| Product Name: | Methyltris(methylethylketoxime)silane |
| Synonyms: | METHYLTRIS(METHYLETHYLKETOXIME)SILANE;butan-2-one o,o',o''-(methylsilylidyne)trioxime;jiajisandingtongwojiguiwan;METHYL TRIS (METHYLETHYLKETOXYMO) SILANE;METHYL TRIBUTANONEOXIMESILANE;Methyltris[[(butan-2-ylidene)amino]oxy]silane;Tris[(1-methylpropylidene)aminooxy](methyl)silane;O,O',O''-(Methylsilanetriyl)tris[2-butanone oxime] |
| CAS: | 22984-54-9 |
| MF: | C13H27N3O3Si |
| MW: | 301.46 |
| EINECS: | 245-366-4 |
| Product Categories: | Silicone series;Oximino;Crosslinkers;Crosslinking Agents;Oximino Silanes;silane |
| Mol File: | 22984-54-9.mol |
|
Methyltris(methylethylketoxime)silane Chemical Properties
| Melting point | -22°C |
| Boiling point | 110 °C |
| density | 0.982 |
| vapor pressure | 0.142Pa at 25℃ |
| refractive index | 1.4548 [25°C] |
| Fp | 90°C |
| Specific Gravity | 0.982 |
| Odor | Mild odor |
| Water Solubility | 36.63g/L |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| InChI | InChI=1S/C13H27N3O3Si/c1-8-11(4)14-17-20(7,18-15-12(5)9-2)19-16-13(6)10-3/h8-10H2,1-7H3/b14-11-,15-12+,16-13+ |
| InChIKey | OGZPYBBKQGPQNU-STFOEXHGSA-N |
| SMILES | [Si](C)(O/N=C(\C)/CC)(O/N=C(\C)/CC)O/N=C(/C)\CC |
| LogP | 1.69 |
| CAS DataBase Reference | 22984-54-9(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Butanone, 2,2',2''-[O,O',O''-(methylsilylidyne)trioxime] (22984-54-9) |
Safety Information
| Risk Statements | 20/21/22-36/37/38-22-20 |
| Safety Statements | 23-26-36/37/39 |
| RIDADR | 1993 |
| TSCA | TSCA listed |
| HazardClass | 3.2 |
| PackingGroup | III |
| HS Code | 29319090 |
Methyltris(methylethylketoxime)silane Usage And Synthesis
| Application | Methyltris(methylethylketoxime)silane is used as a neutral curing agent in silicone sealant formulations. Generally, this silane is used for crosslinking α,ω-silanol polydimethylsiloxanes in the presence of atmospheric moisture.
It is often the main crosslinker of choice for oxime silicone sealants and can be used by itself or in combination with other oxime silanes to provide the sealant with targeted properties (such as desired cure rate, adhesion etc). |
| Chemical Properties | Colorless or yellowish transparent liquid |
| Uses | Methyltris(methylethylketoxime)silane can be used as a silane coupling agent and crosslinker. |
| Flammability and Explosibility | Non flammable |
| Synthesis | Put 340g of methyltrimethoxysilane, 1305g of butanone oxime and 3g of p-toluenesulfonic acid into a 2000ml three-necked reaction flask, turn on the magnetic stirring, control the magnetic stirring at 300 revolutions per minute, and use the programmed heating method for the reaction temperature, which was controlled at 65??-153??, and the reaction time was 6h, which means that the temperature was raised by an average of 14.7?? per hour, and the reaction time was 6h, which meant that the temperature was raised by an average of 14.7?? per hour. During the reaction process, methanol was recovered while reacting, and semi-finished products were obtained at the end of the reaction. The semi-finished product was recovered the excess butanone oxime by distillation under reduced pressure, and the methyltris-butanone oxime silane product obtained at the bottom of the bottle was washed with color and filtered, and finally 737g of methyltris-butanone oxime silane product was obtained, and the product was 10-color, and the product yield reached 97.9%, and the product content was 98.7%. |
Methyltris(methylethylketoxime)silane Preparation Products And Raw materials
| Raw materials | Methyltrichlorosilane |
