Introduction：Basic information about m-PEG9-COOH CAS 2576495-35-5, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
m-PEG9-COOH Basic information
| Product Name: | m-PEG9-COOH |
| Synonyms: | m-PEG9-COOH;2,5,8,11,14,17,20,23,26-Nonaoxanonacosan-29-oic acid;4,7,10,13,16,19,22,25,28-Nonaoxanonacosanoic acid;mPEG8-CH2CH2COOH/4,7,10,13,16,19,22,25,28-Nonaoxanonacosanoic acid;3-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| CAS: | 2576495-35-5 |
| MF: | C20H40O11 |
| MW: | 456.52 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 2576495-35-5.mol |
|
m-PEG9-COOH Chemical Properties
| Boiling point | 536.3±50.0 °C(Predicted) |
| density | 1.111±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C, sealed storage, away from moisture |
| pka | 4.28±0.10(Predicted) |
| form | Liquid |
| color | Colorless to light yellow |
| InChI | InChI=1S/C20H40O11/c1-23-4-5-25-8-9-27-12-13-29-16-17-31-19-18-30-15-14-28-11-10-26-7-6-24-3-2-20(21)22/h2-19H2,1H3,(H,21,22) |
| InChIKey | HVDSDOIAPZITDA-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCOC |
Safety Information
m-PEG9-COOH Usage And Synthesis
| Uses | m-PEG9-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Biological Activity | m-PEG9-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1].PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| IC 50 | PEGs |
| References | [1]. An S, et al. Small-molecule PROTACs: An emerging and promising approach for the development of targeted therapy drugs. EBioMedicine. 2018 Oct;36:553-562 |
m-PEG9-COOH Preparation Products And Raw materials
