Introduction：Basic information about N-(4-Methoxybenzyl)-N-methylamine CAS 702-24-9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
N-(4-Methoxybenzyl)-N-methylamine Basic information
| Product Name: | N-(4-Methoxybenzyl)-N-methylamine |
| Synonyms: | AKOS BC-0897;(4-METHOXY-BENZYL)-METHYL-AMINE;4-METHOXY-N-METHYLBENZYLAMINE;N-(4-METHOXYBENZYL)-N-METHYLAMINE;N-Methyl-4-methoxybenzylamine;4-METHOXY-N-METHYLBENZYLAMINE 95%;(4-methoxyphenyl)-N-methylmethanamine;1-(4-methoxyphenyl)-N-methylmethanamine |
| CAS: | 702-24-9 |
| MF: | C9H13NO |
| MW: | 151.21 |
| EINECS: | 200-002-4 |
| Product Categories: | Amines and Anilines |
| Mol File: | 702-24-9.mol |
|
N-(4-Methoxybenzyl)-N-methylamine Chemical Properties
| Melting point | 238 °C |
| Boiling point | 88 °C |
| density | 1.008 g/mL at 25 °C |
| refractive index | n20/D1.529 |
| Fp | 109℃ |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 10.14±0.10(Predicted) |
| form | Oil |
| color | Clear Beige |
| InChI | InChI=1S/C9H13NO/c1-10-7-8-3-5-9(11-2)6-4-8/h3-6,10H,7H2,1-2H3 |
| InChIKey | AIJFPNKGGAPZFJ-UHFFFAOYSA-N |
| SMILES | C1(CNC)=CC=C(OC)C=C1 |
| CAS DataBase Reference | 702-24-9(CAS DataBase Reference) |
Safety Information
| Hazard Codes | C,Xn |
| Risk Statements | 36/37/38-34-22 |
| Safety Statements | 26-36/37/39 |
| RIDADR | UN 2735 8/PG III |
| WGK Germany | 1 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 2921490090 |
N-(4-Methoxybenzyl)-N-methylamine Usage And Synthesis
| Uses | N-(4-Methoxybenzyl)-N-methylamine is used in the synthetic preparation of many types of compounds, including the synthesis of trifluoromethyl-sulfonimidamides from sulfinamides as well as the preparation of piperazinylquinazoline amine compounds as toll-like receptor 9 signaling antagonists for treatment of immune disorders. |
N-(4-Methoxybenzyl)-N-methylamine Preparation Products And Raw materials
| Raw materials | Sodium hydroxide-->Sodium borohydride-->Methylamine-->p-Anisaldehyde-->4-Methoxybenzyl bromide |
| Preparation Products | N*1*-(4-Methoxy-benzyl)-N*1*-Methyl-ethane-1,2-diaMine |
