Introduction：Basic information about N,N-Dimethylformamide diisopropyl acetal CAS 18503-89-4, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
N,N-Dimethylformamide diisopropyl acetal Basic information
| Product Name: | N,N-Dimethylformamide diisopropyl acetal |
| Synonyms: | 1,1-DIISOPROPOXYTRIMETHYLAMINE;N,N-DIMETHYLFORMAMIDE DIISOPROPYL ACETAL;N,N-DIMETHYLFORMAMIDE DI-N-PROPYL ACETAL;N,N,N-trimethyl-1,1-bis(1-methylethoxy)amine;N,N-Dimethylformamide dimethylacetate;1,1-diisopropoxy-n,n-dimethylmethylamine;Dimethyl(diisopropoxymethyl)amine;N,N-Dimethyl-α,α-bis(isopropyloxy)methanamine |
| CAS: | 18503-89-4 |
| MF: | C9H21NO2 |
| MW: | 175.27 |
| EINECS: | 242-386-5 |
| Product Categories: | |
| Mol File: | 18503-89-4.mol |
|
N,N-Dimethylformamide diisopropyl acetal Chemical Properties
| Boiling point | 79-80 °C60 mm Hg(lit.) |
| density | 0.838 g/mL at 25 °C(lit.) |
| refractive index | n20/D 1.409(lit.) |
| Fp | 74 °F |
| storage temp. | -20°C, protect from light |
| pka | 5.47±0.50(Predicted) |
| form | liquid |
| Appearance | Colorless to light yellow Liquid |
| BRN | 1901978 |
| InChI | InChI=1S/C9H21NO2/c1-7(2)11-9(10(5)6)12-8(3)4/h7-9H,1-6H3 |
| InChIKey | XOZZATXWQMOVHL-UHFFFAOYSA-N |
| SMILES | C(OC(C)C)(OC(C)C)N(C)C |
| CAS DataBase Reference | 18503-89-4(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-10 |
| Safety Statements | 26-36 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| HazardClass | 3.2 |
| PackingGroup | III |
| HS Code | 2922190090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2
Flam. Liq. 3
Skin Irrit. 2
STOT SE 3 |
N,N-Dimethylformamide diisopropyl acetal Usage And Synthesis
| Uses | N,N-Dimethylformamide diisopropyl acetal was used in the quantification of cocaine and its metabolite, benzoyl ecgonine from urine matrix. |
N,N-Dimethylformamide diisopropyl acetal Preparation Products And Raw materials
| Raw materials | bis(dimethylamino)acetonitrile-->Isopropyl alcohol-->Sodium propan-2-olate-->N,N-Dimethylformamide dimethyl acetal |
