N,N-DIMETHYLFORMAMIDE-D7 CAS 4472-41-7
Introduction:Basic information about N,N-DIMETHYLFORMAMIDE-D7 CAS 4472-41-7, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
N,N-DIMETHYLFORMAMIDE-D7 Basic information
| Product Name: | N,N-DIMETHYLFORMAMIDE-D7 |
| Synonyms: | Dimethylformamide-D7 deuteration degree min. 99.5% for NMR spectroscopy MagniSolv;N,N-Dimethylformamide-d7, Isotopic;C-deuterio-N,N-bis-(trideuteriomethyl)-formamide;C-deuterio-N,N-bis-trideuteriomethyl-formamide;Formamide-1-d, N,N-di(methyl-d3)-;Formamide-1-d,N,N-di(methyl-d3)-;N,N-di[2H3]methyl[2H]formamide;N,N-Dimethylformamid-d7 |
| CAS: | 4472-41-7 |
| MF: | C3H7NO |
| MW: | 73.1 |
| EINECS: | 224-745-8 |
| Product Categories: | N,N-Dimethylformamide-d7;Aldrich High Purity NMR Solvents for Routine NMR;Alphabetical Listings;D;High Throughput NMR;Labware;NMR;NMR Solvents;NMR Solvents and Reagents;Routine NMR;Solvent by Application;Solvents;Solvents for High Throughput NMR;Spectroscopy Solvents (IR;Analytical Chemistry;Deuterated Compounds for NMR;NMR Spectrometry;Stable Isotopes;Tubes and Accessories;UV/Vis);Imidazoles |
| Mol File: | 4472-41-7.mol |
N,N-DIMETHYLFORMAMIDE-D7 Chemical Properties
| Melting point | -61°C |
| Melting point | -61°C |
| Boiling point | 153 °C(lit.) |
| Boiling point | 153°C |
| density | d = 1,03 |
| density | 1.03 g/mL at 25 °C(lit.) |
| vapor pressure | 3.77 hPa (20 °C) |
| refractive index | n |
| Fp | 136 °F |
| storage temp. | no restrictions. |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | Liquid |
| color | Colorless |
| explosive limit | 2.2-16%(V) |
| Water Solubility | Soluble in water. |
| BRN | 1908468 |
| Stability: | Stable. Incompatible with strong oxidizing agents. Protect from moisture. |
| InChI | 1S/C3H7NO/c1-4(2)3-5/h3H,1-2H3/i1D3,2D3,3D |
| InChIKey | ZMXDDKWLCZADIW-YYWVXINBSA-N |
| SMILES | [2H]C(=O)N(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| CAS DataBase Reference | 4472-41-7(CAS DataBase Reference) |
Safety Information
| Hazard Codes | T |
| Risk Statements | 61-20/21-36 |
| Safety Statements | 53-45-36/37-26 |
| RIDADR | UN 2265 3/PG 3 |
| WGK Germany | 2 |
| Autoignition Temperature | 440 °C |
| HS Code | 2845 90 10 |
| HazardClass | 3 |
| PackingGroup | III |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Eye Irrit. 2 Flam. Liq. 3 Repr. 1B |
| Toxicity | LD50 orally in Rabbit: 2800 mg/kg LD50 dermal Rabbit 1500 mg/kg |
| Chemical Properties | liquid |
| Uses | It is a common?solvent?used in?NMR spectroscopy. It is also used as a reagent. |
| Uses | N,N-Dimethylformamide-d7 may be used to study its metabolism in rats by 2H NMR spectroscopy. |
| Definition | ChEBI: N,N-dimethylformamide-d7 is a deuterated compound, a member of formamides and a volatile organic compound. |
| General Description | N,N-Dimethylformamide-d7 (DMF-d7) is a deuterated NMR solvent containing 0.03% (v/v) TMS (tetramethylsilane). It is useful in NMR-based research and analyses. Pulsed neutron diffraction measurements of different concentrations of molar lithium chloride (LiCl) solutions in DMF-d7 have been carried out to investigate the chloride ion solvation. |
