Introduction：Basic information about N-[(tert-Butoxy)carbonyl]-D-tryptophan CAS 5241-64-5, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
N-[(tert-Butoxy)carbonyl]-D-tryptophan Basic information
| Product Name: | N-[(tert-Butoxy)carbonyl]-D-tryptophan |
| Synonyms: | BOC-D-TRYPTOPHAN;BOC-D-TRYPTOPHANE;BOC-D-TRP-OH;BOC-D-TRYPTOPHAN-OH;BOC-D-TRYPTOPHANE extrapure;(2R)-2-[(tert-Butoxycarbonyl)amino]-3-(1H-indole-3-yl)propionic acid;N-Boc-D-Trp-OH;Nα-(tert-Butyloxycarbonyl)-D-Tryptophane |
| CAS: | 5241-64-5 |
| MF: | C16H20N2O4 |
| MW: | 304.34 |
| EINECS: | 226-042-1 |
| Product Categories: | Tryptophans;Boc-Amino acid series;Tryptophan [Trp, W];Boc-Amino Acids and Derivative;Amino Acids;Amino Acids (N-Protected);Biochemistry;Boc-Amino Acids;Indoles |
| Mol File: | 5241-64-5.mol |
|
N-[(tert-Butoxy)carbonyl]-D-tryptophan Chemical Properties
| Melting point | 131-136 °C |
| alpha | 19 º (c=1, DMF) |
| Boiling point | 445.17°C (rough estimate) |
| density | 1.1328 (rough estimate) |
| refractive index | 1.5800 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Aqueous Base (Slightly), DMF (Slightly) DMSO (Slightly), Methanol (Slightly) |
| pka | 4.00±0.10(Predicted) |
| form | Solid |
| color | White |
| BRN | 4237334 |
| Major Application | peptide synthesis |
| InChI | 1S/C16H20N2O4/c1-16(2,3)22-15(21)18-13(14(19)20)8-10-9-17-12-7-5-4-6-11(10)12/h4-7,9,13,17H,8H2,1-3H3,(H,18,21)(H,19,20)/t13-/m1/s1 |
| InChIKey | NFVNYBJCJGKVQK-CYBMUJFWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](Cc1c[nH]c2ccccc12)C(O)=O |
| CAS DataBase Reference | 5241-64-5(CAS DataBase Reference) |
Safety Information
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
N-[(tert-Butoxy)carbonyl]-D-tryptophan Usage And Synthesis
| Chemical Properties | WHITE TO CREAM POWDER |
| Uses | Nα-Boc-D-tryptophan is an N-Boc-protected form of D-Tryptophan (T947205). D-Tryptophan is an unnatural isomer of L-Tryptophan (T947210) and is classified as an essential amino acid. D-Tryptophan has been synthesized as part of some potent Oxytocin (Acetate: O878500) antagonists that treat preterm labour. |
| reaction suitability | reaction type: Boc solid-phase peptide synthesis |
N-[(tert-Butoxy)carbonyl]-D-tryptophan Preparation Products And Raw materials
| Preparation Products | DL-Tryptophan-->Leuprorelin-->PENTAGASTRIN |
