Introduction：Basic information about N6-Cbz-L-Lysine CAS 1155-64-2, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
N6-Cbz-L-Lysine Basic information
| Product Name: | N6-Cbz-L-Lysine |
| Synonyms: | LYSINE(Z)-OH;LYS(Z);L-LYSINE(CBZ);H-LYS(CBZ)-OH;H-LYS(Z)-OH;EPSILON-CARBOBENZOXY-L-LYSINE;N6-Carbobenzyloxy-L-lysine;N6-benzyloxycarbonyl-L-lysine |
| CAS: | 1155-64-2 |
| MF: | C14H20N2O4 |
| MW: | 280.32 |
| EINECS: | 214-585-7 |
| Product Categories: | Lysine [Lys, K];Amino Acids and Derivatives;API intermediates;Amino Acids;Amino Acids (N-Protected);Biochemistry;Cbz-Amino Acids;Z-Amino acid series;Amino Acids & Derivatives;Aromatics |
| Mol File: | 1155-64-2.mol |
|
N6-Cbz-L-Lysine Chemical Properties
| Melting point | 259 °C (dec.)(lit.) |
| alpha | 14.4 º (c=1.6 in 1N HCl) |
| Boiling point | 423.04°C (rough estimate) |
| density | 1.1429 (rough estimate) |
| refractive index | 16 ° (C=1.6, 2mol/L HCl) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Aqueous Base, Dilute Acid |
| pka | 2.53±0.24(Predicted) |
| form | Powder |
| color | White to off-white |
| Optical Rotation | [α]20/D +15.5±1°, c = 1% in 1 M HCl |
| BRN | 2222482 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C14H20N2O4/c15-12(13(17)18)8-4-5-9-16-14(19)20-10-11-6-2-1-3-7-11/h1-3,6-7,12H,4-5,8-10,15H2,(H,16,19)(H,17,18)/t12-/m0/s1 |
| InChIKey | CKGCFBNYQJDIGS-LBPRGKRZSA-N |
| SMILES | C(O)(=O)[C@H](CCCCNC(OCC1=CC=CC=C1)=O)N |
| CAS DataBase Reference | 1155-64-2(CAS DataBase Reference) |
Safety Information
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |
N6-Cbz-L-Lysine Usage And Synthesis
| Chemical Properties | white to off-white powder |
| Uses | Protected amino acid |
| reaction suitability | reaction type: solution phase peptide synthesis |
N6-Cbz-L-Lysine Preparation Products And Raw materials
| Preparation Products | (S)-2-PIPERIDINONE-6-CARBOXYLIC ACID-->(S)-N-(5-AMINO-1-CARBOXYPENTYL)IMINODIACETIC ACID HYDRATE-->Z-Lys(Z)-OH-->(2S)-6-amino-2-[[(3S)-3-amino-4-hydroxy-4-oxobutanoyl]amino]hexanoic acid-->6-Oxo-N6-[(phenylmethoxy)carbonyl]-L-lysine |
