NAPHTHALENE-D8 CAS 1146-65-2
Introduction：Basic information about NAPHTHALENE-D8 CAS 1146-65-2, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
NAPHTHALENE-D8 Basic information
| Product Name: | NAPHTHALENE-D8 |
| Synonyms: | OCTADEUTERONAPHTHALENE;NAPHTHALENE-D8;[2H8]Naphthalene;naphthalene-d8(deuteratednaphthalene);Perdeuteronaphthalene;Naphtalene-d8,99 atom % D;NAPHTHALENE-D8, 99 ATOM % D;NAPHTHALENE-D8, 250MG, NEAT |
| CAS: | 1146-65-2 |
| MF: | C10D8 |
| MW: | 136.22 |
| EINECS: | 214-552-7 |
| Product Categories: | 600 Series Wastewater Methods;FumigantsPesticides&Metabolites;Insecticides;Method 625;Pesticides;Alpha Sort;Chemical Class;N;NA - NIAnalytical Standards;Naphthalenes;N-OAlphabetic;Volatiles/ Semivolatiles;Alphabetical Listings;N-O;Stable Isotopes;LabeledEPA |
| Mol File: | 1146-65-2.mol |
NAPHTHALENE-D8 Chemical Properties
| Melting point | 80-82 °C(lit.) |
| Boiling point | 218 °C(lit.) |
| density | 1.242 g/cm3 |
| vapor density | 4.4 (vs air) |
| vapor pressure | 0.03 mm Hg ( 25 °C) |
| refractive index | 1.58075 (589.3 nm 98℃) |
| Fp | 174 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Crystals or Crystalline Powder |
| color | White |
| explosive limit | 0.9-5.9%(V) |
| Stability: | Stable. Incompatible with oxidizing agents. Flammable. |
| Major Application | electronics |
| InChI | 1S/C10H8/c1-2-6-10-8-4-3-7-9(10)5-1/h1-8H/i1D,2D,3D,4D,5D,6D,7D,8D |
| InChIKey | UFWIBTONFRDIAS-PGRXLJNUSA-N |
| SMILES | [2H]c1c([2H])c([2H])c2c([2H])c([2H])c([2H])c([2H])c2c1[2H] |
| CAS DataBase Reference | 1146-65-2(CAS DataBase Reference) |
| EPA Substance Registry System | Naphthalene-d8 (1146-65-2) |
| CAS Number Unlabeled | 91-20-3 |
Safety Information
| Hazard Codes | Xn,N |
| Risk Statements | 22-40-50/53-67-36/37/38 |
| Safety Statements | 36/37-46-60-61-24/25-23 |
| RIDADR | UN 1334 4.1/PG 3 |
| WGK Germany | 3 |
| HazardClass | 4.1 |
| PackingGroup | III |
| HS Code | 28459000 |
| Storage Class | 4.1B - Flammable solid hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Carc. 2 Flam. Sol. 2 |
| Chemical Properties | white crystals |
| Uses | Naphthalene-d8 can be intended for use as an internal standard for the quantification of Naphthalene by GC- or LC-mass spectrometry. |
| Uses | May be used as an analytical standard |
NAPHTHALENE-D8 Preparation Products And Raw materials
