Introduction:Basic information about CAS 61551-49-3|5,6,7,8-tetrahydronaphthalene-2-sulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5,6,7,8-tetrahydronaphthalene-2-sulfonyl chloride |
|---|
| CAS Number | 61551-49-3 | Molecular Weight | 230.71100 |
|---|
| Density | 1.334 g/cm3 | Boiling Point | 341.8ºC at 760 mmHg |
|---|
| Molecular Formula | C10H11ClO2S | Melting Point | / |
|---|
| MSDS | USA | Flash Point | 160.5ºC |
|---|
Names
| Name | 5,6,7,8-tetrahydronaphthalene-2-sulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.334 g/cm3 |
|---|
| Boiling Point | 341.8ºC at 760 mmHg |
|---|
| Molecular Formula | C10H11ClO2S |
|---|
| Molecular Weight | 230.71100 |
|---|
| Flash Point | 160.5ºC |
|---|
| Exact Mass | 230.01700 |
|---|
| PSA | 42.52000 |
|---|
| LogP | 3.57370 |
|---|
| Index of Refraction | 1.571 |
|---|
| InChIKey | FNEIMPFRVQQOMV-UHFFFAOYSA-N |
|---|
| SMILES | C1CCC2=C(C1)C=CC(=C2)S(=O)(=O)Cl |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| RIDADR | NONH for all modes of transport |
|---|
| HS Code | 2904909090 |
|---|
Customs
| HS Code | 2904909090 |
|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 5,6,7,8-tetrahydro-2-naphthalenesulphonyl chloride |
| 5,6,7,8-Tetrahydro-naphthalin-2-sulfonylchlorid |
| 6-chlorosulfonyl-1,2,3,4-tetrahydronaphthalene |
| 1,2,3,4-tetrahydronaphthalene-6-sulfonyl chloride |
| F2169-1119 |
| 5,6,7,8-tetrahydro-naphthalene-2-sulfonyl chloride |
| 5,6,7,8-Tetrahydro-2-naphthalenesulfonyl chloride |