Introduction：Basic information about N-Ethyl-p-toluenesulfonamide CAS 80-39-7, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
N-Ethyl-p-toluenesulfonamide Basic information
| Product Name: | N-Ethyl-p-toluenesulfonamide |
| Synonyms: | Benzenesulfonamide, N-ethyl-4-methyl-;Ethyl toluenesulfonamide;Ethylp-toluenesulfonamide;n-ethyl-4-methyl-benzenesulfonamid;n-ethyl-4-methylbenzenesulfonamide;N-Ethyl-4-methyl-benzenesulfonamide;N-Ethyltoluene-4-sulfonamide for synthesis;Brinzolamide Impurity 1 |
| CAS: | 80-39-7 |
| MF: | C9H13NO2S |
| MW: | 199.27 |
| EINECS: | 201-275-1 |
| Product Categories: | Nitrogen Compounds;Organic Building Blocks;Protected Amines |
| Mol File: | 80-39-7.mol |
|
N-Ethyl-p-toluenesulfonamide Chemical Properties
| Melting point | 63-65 °C(lit.) |
| Boiling point | 208 °C745 mm Hg(lit.) |
| density | 1.26 g/cm3 |
| refractive index | 1.5270 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 11.86±0.50(Predicted) |
| color | White to Off-White |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Cosmetics Ingredients Functions | FILM FORMING
PLASTICISER |
| InChI | InChI=1S/C9H13NO2S/c1-3-10-13(11,12)9-6-4-8(2)5-7-9/h4-7,10H,3H2,1-2H3 |
| InChIKey | OHPZPBNDOVQJMH-UHFFFAOYSA-N |
| SMILES | C1(S(NCC)(=O)=O)=CC=C(C)C=C1 |
| LogP | 1.960 (est) |
| CAS DataBase Reference | 80-39-7(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Toluenesulfonamide, n-ethyl-(80-39-7) |
| EPA Substance Registry System | N-Ethyl-p-toluenesulfonamide (80-39-7) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29350090 |
| Storage Class | 13 - Non Combustible Solids |
N-Ethyl-p-toluenesulfonamide Usage And Synthesis
| Chemical Properties | off-white crystalline solid |
| Uses | Plasticizer. |
| Uses | N-Ethyl-4-toluene sulfonamide is a resin carrier in dental materials used for isolating cavities below restorations; plasticizer in polyvinyl alcohollacquers, polyamides, cellulose acetate, etc. |
| Uses | N-?Ethyl-?p-?toluenesulfonamide is a reagent used in the sulfonamidation of imidazopyridines. |
| General Description | Platelets (from dilute alcohol or ligroin) or off-white solid. |
| Air & Water Reactions | Insoluble in water. |
| Reactivity Profile | An amide. Organic amides/imides react with azo and diazo compounds to generate toxic gases. Flammable gases are formed by the reaction of organic amides/imides with strong reducing agents. Amides are very weak bases (weaker than water). Imides are less basic yet and in fact react with strong bases to form salts. That is, they can react as acids. Mixing amides with dehydrating agents such as P2O5 or SOCl2 generates the corresponding nitrile. The combustion of these compounds generates mixed oxides of nitrogen (NOx). |
| Fire Hazard | Flash point data for N-Ethyl-p-toluenesulfonamide are not available; however, N-Ethyl-p-toluenesulfonamide is probably combustible. |
N-Ethyl-p-toluenesulfonamide Preparation Products And Raw materials
| Raw materials | Ethyl acetate-->Sodium bicarbonate-->Tosyl chloride-->Ethylamine |
| Preparation Products | Benzenesulfonamide, N-ethyl-2,4-dimethyl--->N-(2,2-Dimethoxyethyl)-4-methylbenzenesulfonamide |
