N-OCTANE-D18 CAS 17252-77-6
Introduction:Basic information about N-OCTANE-D18 CAS 17252-77-6, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
N-OCTANE-D18 Basic information
| Product Name: | N-OCTANE-D18 |
| Synonyms: | octadecadeuterio-octane;octadecadeutero-octane;N-OCTANE-D18;OCTANE-D18;(2H18)octane;OCTANE-D18 98 PLUS ATOM % D;OCTANE-D18, 98+ ATOM % D;n-Octane-d18(Isotopic) |
| CAS: | 17252-77-6 |
| MF: | C8D18 |
| MW: | 132.34 |
| EINECS: | 241-285-3 |
| Product Categories: | Additional NMR Solvents;Aldrich High Purity NMR Solvents for Routine NMR;Alphabetical Listings;High Throughput NMR;Labware;NMR;NMR Solvents;NMR Solvents and Reagents;N-O;Routine NMR;Solvent by Application;Solvents;Solvents for High Throughput NMR;Spectroscopy Solvents (IR;Stable Isotopes;Tubes and Accessories;UV/Vis);NMR Solvents and Reagents;NMRStable Isotopes;N-OStable Isotopes;Stable Isotopes;Alphabetical Listings;NMR - Solvents |
| Mol File: | 17252-77-6.mol |
N-OCTANE-D18 Chemical Properties
| Melting point | -57 °C (lit.) |
| Boiling point | 125-127 °C |
| density | 0.815 g/mL at 25 °C (lit.) |
| refractive index | n |
| Fp | 60 °F |
| storage temp. | Flammables area |
| solubility | 0.0007g/l |
| form | Liquid |
| Specific Gravity | 0.815 |
| explosive limit | 0.8-6.5%(V) |
| Stability: | Stable. Highly flammable. Readily forms explosive mixtures with air. |
| InChI | 1S/C8H18/c1-3-5-7-8-6-4-2/h3-8H2,1-2H3/i1D3,2D3,3D2,4D2,5D2,6D2,7D2,8D2 |
| InChIKey | TVMXDCGIABBOFY-VAZJTQEUSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H] |
| CAS Number Unlabeled | 111-65-9 |
Safety Information
| Hazard Codes | F,Xn,N |
| Risk Statements | 11-67-65-50/53-38 |
| Safety Statements | 9-16-29-33-62-61-60 |
| RIDADR | UN 1262 3/PG 2 |
| WGK Germany | 3 |
| HazardClass | 3 |
| PackingGroup | II |
| HS Code | 28459000 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Asp. Tox. 1 Flam. Liq. 2 Skin Irrit. 2 STOT SE 3 |
| Chemical Properties | colourless liquid |
| Uses | Octane-d18 has been used to evaluate the separation factors of the deuterated octane isomers by gas chromatography (GC). |
| General Description | Octane-d18 is a deuterated NMR solvent. It is useful in NMR-based research and analyses. It can be prepared starting from n-octane. It undergoes H/D (Hydrogen/Deuterium) exchange reaction with mono pinacolboryl complex at 110°C. |
