Introduction:Basic information about O,O'-Dioctadecylpentaerythritol bis(phosphite) CAS 3806-34-6, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
O,O'-Dioctadecylpentaerythritol bis(phosphite) Basic information
| Product Name: | O,O'-Dioctadecylpentaerythritol bis(phosphite) |
| Synonyms: | -2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane;3,9-Bis(octadecyloxy);Distearylpentaerythritol Diphosphite;Distearyl Pentaerythrityl Diphsophite;Weston 618;2,4,8,10-Tetraoxa-3,9-diphosphaspiro5.5undecane, 3,9-bis(octadecyloxy)-;CYCLICNEOPENTANETETRAYLBIS(OCTADECYLPHOSPHITE);AO-118 |
| CAS: | 3806-34-6 |
| MF: | C41H82O6P2 |
| MW: | 733.03 |
| EINECS: | 223-276-6 |
| Product Categories: | Polymer Additives;Polymer Science;Stabilizers |
| Mol File: | 3806-34-6.mol |
|
O,O'-Dioctadecylpentaerythritol bis(phosphite) Chemical Properties
| Melting point | 44-47 °C(lit.) |
| Boiling point | 692.2±55.0 °C(Predicted) |
| density | 1.05[at 20℃] |
| vapor pressure | 0Pa at 25℃ |
| Fp | >230 °F |
| storage temp. | 2-8°C |
| form | solid |
| Water Solubility | 330ng/L at 25℃ |
| InChI | InChI=1S/C41H82O6P2/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-42-48-44-37-41(38-45-48)39-46-49(47-40-41)43-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h3-40H2,1-2H3 |
| InChIKey | PZRWFKGUFWPFID-UHFFFAOYSA-N |
| SMILES | C1C2(COP(OCCCCCCCCCCCCCCCCCC)OC2)COP(OCCCCCCCCCCCCCCCCCC)O1 |
| LogP | 16.4 at 25℃ |
| EPA Substance Registry System | 2,4,8,10-Tetraoxa-3,9-diphosphaspiro[5.5]undecane, 3,9-bis(octadecyloxy)- (3806-34-6) |
Safety Information
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29092000 |
| Storage Class | 11 - Combustible Solids |
| Hazardous Substances Data | 3806-34-6(Hazardous Substances Data) |
O,O'-Dioctadecylpentaerythritol bis(phosphite) Usage And Synthesis
| Chemical Properties | White waxy solid. Melting point 54-56°C, relative density 0.940-0.960 (50/15.5°C), refractive index 1.4610-1.4660 (50°C). Solubility (g/100g of solvent, 25℃): benzene 14.7, hashane 0.3, chloroform 45.0, acetone 0.3, methanol 0.3; insoluble in water. |
| Uses | Color stabilizer for polymers |
| General Description | 3,9-Bis(octadecyloxy)-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane is a diphosphaspiro compound which contains two phosphorus atoms and can be used as an antioxidant and as a reducing agent. |
| Flammability and Explosibility | Non flammable |
O,O'-Dioctadecylpentaerythritol bis(phosphite) Preparation Products And Raw materials
| Raw materials | Phosphorus trichloride-->Pentaerythritol-->1-Octadecanol-->Triphenyl phosphite |